2,6-difluoro-4-(9-(3-phenoxyphenyl)-9H-purin-2-ylamino)phenol

ID: ALA4845736

PubChem CID: 164608944

Max Phase: Preclinical

Molecular Formula: C23H15F2N5O2

Molecular Weight: 431.40

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Oc1c(F)cc(Nc2ncc3ncn(-c4cccc(Oc5ccccc5)c4)c3n2)cc1F

Standard InChI:  InChI=1S/C23H15F2N5O2/c24-18-9-14(10-19(25)21(18)31)28-23-26-12-20-22(29-23)30(13-27-20)15-5-4-8-17(11-15)32-16-6-2-1-3-7-16/h1-13,31H,(H,26,28,29)

Standard InChI Key:  KVYJDRGXUZTGQY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   11.4025  -11.5372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4013  -12.3645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1161  -12.7774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8326  -12.3640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8296  -11.5336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1143  -11.1244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1119  -10.2994    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.6879  -11.1248    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.6865  -12.7764    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   13.5476  -12.7754    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.2615  -12.3618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9732  -12.7736    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.9655  -11.1236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2552  -11.5389    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.6825  -11.5286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6893  -12.3568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4875  -12.6270    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.9604  -11.9321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4680  -11.2662    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.7493  -13.4073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2013  -14.0254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4628  -14.8070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2722  -14.9717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8193  -14.3486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5548  -13.5694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9162  -15.4248    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.1078  -15.2604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8489  -14.4785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0413  -14.3138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4937  -14.9321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7594  -15.7176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5663  -15.8786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  1  8  1  0
  2  9  1  0
  4 10  1  0
 10 11  1  0
 11 12  2  0
 12 16  1  0
 15 13  1  0
 13 14  2  0
 14 11  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 15  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 17 20  1  0
 22 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4845736

    ---

Associated Targets(Human)

RPS6KA3 Tchem Ribosomal protein S6 kinase alpha 3 (4284 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 431.40Molecular Weight (Monoisotopic): 431.1194AlogP: 5.34#Rotatable Bonds: 5
Polar Surface Area: 85.09Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.28CX Basic pKa: 1.08CX LogP: 5.19CX LogD: 5.13
Aromatic Rings: 5Heavy Atoms: 32QED Weighted: 0.37Np Likeness Score: -1.24

References

1. Casalvieri KA, Matheson CJ, Warfield BM, Backos DS, Reigan P..  (2021)  N-Substituted pyrrolopyrimidines and purines as p90 ribosomal S6 protein kinase-2 (RSK2) inhibitors.,  41  [PMID:34034149] [10.1016/j.bmc.2021.116220]

Source