N-((2S)-3-hydroxy-1-((2S)-1-hydroxy-1-((R)-2-methyloxiran-2-yl)-3-phenylpropan-2-ylamino)-1-oxopropan-2-yl)-6-oxo-1,6-dihydropyridine-2-carboxamide

ID: ALA4845896

PubChem CID: 164609059

Max Phase: Preclinical

Molecular Formula: C21H25N3O6

Molecular Weight: 415.45

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@]1(C(O)[C@H](Cc2ccccc2)NC(=O)[C@H](CO)NC(=O)c2cccc(=O)[nH]2)CO1

Standard InChI:  InChI=1S/C21H25N3O6/c1-21(12-30-21)18(27)15(10-13-6-3-2-4-7-13)23-20(29)16(11-25)24-19(28)14-8-5-9-17(26)22-14/h2-9,15-16,18,25,27H,10-12H2,1H3,(H,22,26)(H,23,29)(H,24,28)/t15-,16-,18?,21+/m0/s1

Standard InChI Key:  WPKBTFXXDYIAOB-QZOPPTLMSA-N

Molfile:  

 
     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
   19.5531   -3.2629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9677   -3.9812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3820   -3.2605    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.8302   -3.1521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8302   -3.9771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5398   -4.3835    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.2534   -3.9771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2534   -3.1521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5398   -2.7335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1147   -4.3885    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.9689   -4.3885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9677   -5.2135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.6816   -3.9791    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.3971   -4.3906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1137   -3.9812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8251   -4.3926    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.1149   -3.1562    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.3959   -5.2156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1114   -5.6311    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.5418   -3.9832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2573   -4.3947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6854   -4.3967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5430   -3.1583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0462   -2.5600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8144   -2.6980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3174   -2.1005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0500   -1.3635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2748   -1.2315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7751   -1.8302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2584   -5.2197    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  1  3  1  0
  4  5  1  0
  4  9  2  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  5 10  2  0
  7 11  1  0
 11 12  2  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  2  0
 14 18  1  6
 18 19  1  0
 16 20  1  0
 20 21  1  0
 21  2  1  0
  2 22  1  6
 20 23  1  1
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 21 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4845896

    ---

Associated Targets(Human)

PSMB9 Tchem Proteasome subunit beta type-9 (308 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PSMB8 Tclin Proteasome subunit beta type-8 (743 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 415.45Molecular Weight (Monoisotopic): 415.1743AlogP: -0.66#Rotatable Bonds: 9
Polar Surface Area: 144.05Molecular Species: NEUTRALHBA: 6HBD: 5
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 9.57CX Basic pKa: CX LogP: -0.96CX LogD: -0.96
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.34Np Likeness Score: 0.44

References

1. Lee MJ, Bhattarai D, Jang H, Baek A, Yeo IJ, Lee S, Miller Z, Lee S, Hong JT, Kim DE, Lee W, Kim KB..  (2021)  Macrocyclic Immunoproteasome Inhibitors as a Potential Therapy for Alzheimer's Disease.,  64  (15.0): [PMID:34309393] [10.1021/acs.jmedchem.1c00291]

Source