Bufogargarizin D

ID: ALA4846248

PubChem CID: 164609122

Max Phase: Preclinical

Molecular Formula: C23H26O4

Molecular Weight: 366.46

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@]12CC[C@@H]3C4=C(C[C@H]3[C@@]1(O)CC[C@@H]2c1ccc(=O)oc1)C(=O)C=CCC4

Standard InChI:  InChI=1S/C23H26O4/c1-22-10-8-16-15-4-2-3-5-20(24)17(15)12-19(16)23(22,26)11-9-18(22)14-6-7-21(25)27-13-14/h3,5-7,13,16,18-19,26H,2,4,8-12H2,1H3/t16-,18-,19-,22-,23+/m1/s1

Standard InChI Key:  RDOABMLJNQGVOD-PPDJZNBDSA-N

Molfile:  

 
     RDKit          2D

 29 33  0  0  0  0  0  0  0  0999 V2000
    5.0517   -4.3171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7570   -3.9044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4623   -4.3171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4623   -5.1308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2361   -5.3823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7145   -4.7240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2362   -4.0657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4900   -3.2904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2907   -3.1223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5440   -2.3491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0001   -1.7387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1995   -1.9068    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9427   -2.6854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7570   -5.5387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0478   -5.1320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5893   -6.3389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4409   -5.6823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7765   -6.4267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4036   -7.1596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6436   -5.4811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6019   -7.3274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9902   -5.9794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9746   -6.8005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9003   -7.8085    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2556   -0.9625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4550   -3.4999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4550   -5.9473    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7492   -4.7215    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3377   -4.7215    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1 15  1  0
  1  2  1  0
 14  4  1  0
  3  2  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  3  1  0
  8  9  1  0
  8 13  2  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
  7  8  1  1
 14 15  1  0
 15 17  1  0
 18 16  1  0
 16 14  1  0
 17 18  2  0
 18 19  1  0
 17 20  1  0
 19 21  1  0
 20 22  1  0
 21 23  2  0
 22 23  1  0
 19 24  2  0
 11 25  2  0
  3 26  1  1
  4 27  1  1
 14 28  1  1
 15 29  1  6
M  END

Alternative Forms

  1. Parent:

    ALA4846248

    ---

Associated Targets(Human)

SK-MEL (619 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Danio rerio (3092 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 366.46Molecular Weight (Monoisotopic): 366.1831AlogP: 3.90#Rotatable Bonds: 1
Polar Surface Area: 67.51Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 0.28CX LogP: 3.24CX LogD: 3.24
Aromatic Rings: 1Heavy Atoms: 27QED Weighted: 0.82Np Likeness Score: 2.77

References

1. Zhou SW, Quan JY, Li ZW, Ye G, Shang Z, Chen ZP, Wang L, Li XY, Zhang XQ, Li J, Liu JS, Tian HY..  (2021)  Bufadienolides from the Eggs of the Toad Bufo bufo gargarizans and Their Antimelanoma Activities.,  84  (5.0): [PMID:33882233] [10.1021/acs.jnatprod.0c00840]

Source