The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4846267
PubChem CID: 164609196
Max Phase: Preclinical
Molecular Formula: C32H29N3O10
Molecular Weight: 615.60
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc([C@@H]2c3cc4c(cc3[C@H](n3cc(COc5ccc6c(c5)OCO6)nn3)[C@H]3COC(=O)[C@H]23)OCO4)cc(OC)c1OC
Standard InChI: InChI=1S/C32H29N3O10/c1-37-26-6-16(7-27(38-2)31(26)39-3)28-19-9-24-25(45-15-44-24)10-20(19)30(21-13-41-32(36)29(21)28)35-11-17(33-34-35)12-40-18-4-5-22-23(8-18)43-14-42-22/h4-11,21,28-30H,12-15H2,1-3H3/t21-,28+,29-,30-/m0/s1
Standard InChI Key: FXTPALJMNLZDLM-MMNYTADISA-N
Molfile:
RDKit 2D
47 54 0 0 0 0 0 0 0 0999 V2000
38.3696 -20.6877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9393 -21.5127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3696 -21.5127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6524 -21.9231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9393 -20.6877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6524 -20.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6524 -22.7481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1573 -21.7614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2179 -21.9231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2179 -20.2730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6440 -24.3940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6382 -21.0981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.1573 -20.4306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9310 -23.9836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3571 -23.9753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5048 -20.6877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5048 -21.5127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9310 -23.1586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3571 -23.1586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7296 -21.7739 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.7171 -20.4347 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.2445 -21.1105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4060 -22.5491 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.6524 -19.4439 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.6440 -25.2190 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.2179 -24.3858 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.0702 -24.3858 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.9310 -25.6337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5007 -23.9753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0702 -25.2108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3655 -22.3336 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
38.3655 -19.8627 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
38.3198 -18.9590 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.0648 -18.1743 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.2397 -18.1743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9850 -18.9590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7572 -17.5103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0910 -16.7604 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.6085 -16.0963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9451 -15.3489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3129 -15.5256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7967 -16.1862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6460 -14.7707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4623 -14.6846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6326 -13.8816 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.9215 -13.4714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3119 -14.0211 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 5 1 0
3 1 1 0
4 3 1 0
5 6 1 0
6 1 1 0
4 7 1 6
8 3 1 0
9 2 2 0
10 5 2 0
11 15 1 0
12 13 1 0
13 1 1 0
14 18 1 0
15 19 2 0
16 10 1 0
17 16 2 0
18 7 2 0
19 7 1 0
20 17 1 0
21 16 1 0
22 21 1 0
23 8 2 0
6 24 1 6
25 11 1 0
26 14 1 0
27 15 1 0
28 25 1 0
29 26 1 0
30 27 1 0
3 31 1 1
1 32 1 6
12 8 1 0
4 2 1 0
9 17 1 0
11 14 2 0
20 22 1 0
24 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 24 1 0
35 37 1 0
37 38 1 0
38 39 1 0
39 40 2 0
40 44 1 0
43 41 1 0
41 42 2 0
42 39 1 0
43 44 2 0
44 45 1 0
45 46 1 0
46 47 1 0
47 43 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 615.60Molecular Weight (Monoisotopic): 615.1853AlogP: 3.86#Rotatable Bonds: 8Polar Surface Area: 130.85Molecular Species: NEUTRALHBA: 13HBD: ┄#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.43CX LogD: 3.43Aromatic Rings: 4Heavy Atoms: 45QED Weighted: 0.27Np Likeness Score: 0.19
References 1. Xiao J, Gao M, Sun Z, Diao Q, Wang P, Gao F.. (2020) Recent advances of podophyllotoxin/epipodophyllotoxin hybrids in anticancer activity, mode of action, and structure-activity relationship: An update (2010-2020)., 208 [PMID:32992133 ] [10.1016/j.ejmech.2020.112830 ]