(R)-3-(4-Methoxy-phenyl)-7-methyl-4-oxo-10-oxa-3-aza-tricyclo[5.2.1.0(1,5)]dec-8-ene-6-carboxylic acid ((R)-1,7,7-trimethyl-bicyclo[2.2.1]hept-2-ylidene)-hydrazide

ID: ALA4846369

PubChem CID: 164609448

Max Phase: Preclinical

Molecular Formula: C27H33N3O4

Molecular Weight: 463.58

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(N2CC34C=CC(C)(O3)C(C(=O)N/N=C3\C[C@H]5CC[C@]3(C)C5(C)C)C4C2=O)cc1

Standard InChI:  InChI=1S/C27H33N3O4/c1-24(2)16-10-11-25(24,3)19(14-16)28-29-22(31)20-21-23(32)30(17-6-8-18(33-5)9-7-17)15-27(21)13-12-26(20,4)34-27/h6-9,12-13,16,20-21H,10-11,14-15H2,1-5H3,(H,29,31)/b28-19+/t16-,20?,21?,25+,26?,27?/m1/s1

Standard InChI Key:  UTNQTLUVVPRWBH-IBLSFZKWSA-N

Molfile:  

 
     RDKit          2D

 35 40  0  0  0  0  0  0  0  0999 V2000
   21.4188  -17.7971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2147  -17.3422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4234  -16.8794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3265  -16.9380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9031  -16.9380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9031  -17.7634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6186  -18.1719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3298  -17.7634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6186  -16.5210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0430  -18.1771    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.7614  -17.7655    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.4745  -18.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4733  -19.0046    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.7234  -18.9901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1888  -17.7676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6221  -16.9523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9050  -16.5363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1866  -16.9461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9820  -17.1527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.7691  -16.2221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6166  -17.7780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9012  -18.1824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0675  -18.9846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8813  -19.0771    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.2190  -18.3278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2888  -19.7938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8681  -20.5035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2750  -21.2197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1002  -21.2255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5170  -20.5093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1078  -19.7959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5052  -19.6004    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.5134  -21.9499    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.0927  -22.6697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6186  -15.6960    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  5  6  1  0
  5  9  1  0
  6  7  1  0
  7  8  1  0
  8  4  1  0
  4  9  1  0
  8 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
  9  2  1  0
  7  2  1  0
  7 14  1  1
 15 12  1  0
 15 22  1  0
 15 18  1  0
 21 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 21 19  1  0
 18 20  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 21  1  0
 24 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 23 32  2  0
 29 33  1  0
 33 34  1  0
  9 35  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4846369

    ---

Associated Targets(Human)

HEK-293T (167025 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

MDCK (10148 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Orthohantavirus hantanense (22 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Vesicular stomatitis virus (4460 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 463.58Molecular Weight (Monoisotopic): 463.2471AlogP: 3.69#Rotatable Bonds: 4
Polar Surface Area: 80.23Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 11.77CX Basic pKa: 1.42CX LogP: 3.14CX LogD: 3.14
Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.55Np Likeness Score: 0.27

References

1. Yarovaya OI, Kovaleva KS, Zaykovskaya AA, Yashina LN, Scherbakova NS, Scherbakov DN, Borisevich SS, Zubkov FI, Antonova AS, Peshkov RY, Eltsov IV, Pyankov OV, Maksyutov RA, Salakhutdinov NF..  (2021)  New class of hantaan virus inhibitors based on conjugation of the isoindole fragment to (+)-camphor or (-)-fenchone hydrazonesv.,  40  [PMID:33705902] [10.1016/j.bmcl.2021.127926]

Source