2-(((2S,3S)-1-(4-(2H-tetrazol-5-yl)benzyl)-2-phenylpiperidin-3-yl)oxy)-2-(3,5-dichlorophenyl)ethan-1-ol

ID: ALA4846392

PubChem CID: 164609568

Max Phase: Preclinical

Molecular Formula: C27H27Cl2N5O2

Molecular Weight: 524.45

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  OC[C@@H](O[C@H]1CCCN(Cc2ccc(-c3nn[nH]n3)cc2)[C@H]1c1ccccc1)c1cc(Cl)cc(Cl)c1

Standard InChI:  InChI=1S/C27H27Cl2N5O2/c28-22-13-21(14-23(29)15-22)25(17-35)36-24-7-4-12-34(26(24)19-5-2-1-3-6-19)16-18-8-10-20(11-9-18)27-30-32-33-31-27/h1-3,5-6,8-11,13-15,24-26,35H,4,7,12,16-17H2,(H,30,31,32,33)/t24-,25+,26-/m0/s1

Standard InChI Key:  FBIBLLXVIMHLCX-NXCFDTQHSA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   14.5980   -3.7640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5980   -4.5812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3033   -4.9857    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.0086   -4.5812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0086   -3.7640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3033   -3.3513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7175   -3.3575    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.7157   -4.9908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7113   -5.8081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4176   -6.2176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1269   -5.8100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1255   -4.9886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4186   -4.5827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7199   -2.5403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4288   -2.1338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1351   -2.5469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8435   -2.1411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8463   -1.3230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1348   -0.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4293   -1.3207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1343   -0.0953    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   19.5498   -2.5521    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   15.3033   -5.8029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0134   -2.1297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0158   -1.3125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.5956   -6.2115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8892   -5.7985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1820   -6.2064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1815   -7.0245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8942   -7.4329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5985   -7.0226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4737   -7.4348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7262   -7.1054    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.1797   -7.7144    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5901   -8.4223    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.3900   -8.2507    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  5  7  1  6
  4  8  1  6
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  7 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 19 21  1  0
 17 22  1  0
  3 23  1  0
 14 24  1  6
 24 25  1  0
 23 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 29 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  1  0
 35 36  2  0
 36 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4846392

    ---

Associated Targets(Human)

PRKG1 Tchem cGMP-dependent protein kinase 1 beta (2814 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 524.45Molecular Weight (Monoisotopic): 523.1542AlogP: 5.63#Rotatable Bonds: 8
Polar Surface Area: 87.16Molecular Species: ACIDHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 6.29CX Basic pKa: 7.98CX LogP: 4.78CX LogD: 4.86
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.31Np Likeness Score: -0.70

References

1. Hanisak J, Soriano A, Adam GC, Basso A, Bauman D, Bell D, Frank E, O'Donnell G, Tawa P, Verras A, Yu Y, Zhang L, Seganish WM..  (2021)  Discovery of the First Non-cGMP Mimetic Small Molecule Activators of cGMP-Dependent Protein Kinase 1 α (PKG1α).,  12  (8.0): [PMID:34413956] [10.1021/acsmedchemlett.1c00264]

Source