The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3(7)-Z-3-Docosylidene-5R-(hydroxymethyl)tetrahydrofuran-2-one ID: ALA4846430
PubChem CID: 164608912
Max Phase: Preclinical
Molecular Formula: C27H50O3
Molecular Weight: 422.69
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCCCCCCCCCCCCCC/C=C1/C[C@H](CO)OC1=O
Standard InChI: InChI=1S/C27H50O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-25-23-26(24-28)30-27(25)29/h22,26,28H,2-21,23-24H2,1H3/b25-22-/t26-/m1/s1
Standard InChI Key: FGOCMKXAWIANLI-XIYFGJGBSA-N
Molfile:
RDKit 2D
30 30 0 0 0 0 0 0 0 0999 V2000
7.2392 -13.9872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9510 -13.5786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6587 -13.9872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3705 -13.5786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0824 -13.9872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4885 -13.6548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9376 -14.2662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3504 -14.9781 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1538 -14.8040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7611 -15.3549 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1208 -14.1808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6404 -14.8419 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7891 -13.5768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4978 -13.9836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2045 -13.5732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9132 -13.9801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6199 -13.5697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3286 -13.9765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0353 -13.5661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7440 -13.9729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4507 -13.5626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1594 -13.9694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8661 -13.5590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5748 -13.9658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2815 -13.5554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9903 -13.9623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6969 -13.5519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4057 -13.9587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1124 -13.5483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8211 -13.9551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 1 0
4 5 1 0
1 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 1 1 0
9 10 2 0
7 11 1 1
11 12 1 0
5 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 422.69Molecular Weight (Monoisotopic): 422.3760AlogP: 8.04#Rotatable Bonds: 21Polar Surface Area: 46.53Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 9.48CX LogD: 9.48Aromatic Rings: ┄Heavy Atoms: 30QED Weighted: 0.12Np Likeness Score: 1.12
References 1. Londero VS, Costa-Silva TA, Antar GM, Baitello JB, de Oliveira LVF, Camilo FF, Batista ANL, Batista JM, Tempone AG, Lago JHG.. (2021) Antitrypanosomal Lactones from Nectandra barbellata ., 84 (5.0): [PMID:33857368 ] [10.1021/acs.jnatprod.0c01303 ]