The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Methyl 3-O-((5-ethoxycarbonyl)1-methyl-1H-benzo[d]imidazole-2-ylmethyl)-methoxy)-beta-D-galactopyranoside ID: ALA4846446
PubChem CID: 164608956
Max Phase: Preclinical
Molecular Formula: C19H26N2O8
Molecular Weight: 410.42
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)c1ccc2c(c1)nc(CO[C@H]1[C@@H](O)[C@@H](CO)O[C@@H](OC)[C@@H]1O)n2C
Standard InChI: InChI=1S/C19H26N2O8/c1-4-27-18(25)10-5-6-12-11(7-10)20-14(21(12)2)9-28-17-15(23)13(8-22)29-19(26-3)16(17)24/h5-7,13,15-17,19,22-24H,4,8-9H2,1-3H3/t13-,15+,16-,17+,19-/m1/s1
Standard InChI Key: UEMWLTQCKAPTNV-LXJHJBAVSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
11.1377 -3.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1377 -4.2043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8497 -4.6125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5617 -4.2043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5617 -3.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8497 -2.9626 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8497 -5.4375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4238 -4.6178 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.2774 -2.9688 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4220 -2.9688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4196 -2.1438 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.2757 -4.6178 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.9907 -3.3834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1353 -5.8501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1353 -6.6751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4720 -7.1626 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.8068 -7.1626 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5520 -7.9472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7300 -7.9470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3207 -8.6576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7321 -9.3689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5573 -9.3652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9629 -8.6539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5914 -6.9074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3215 -10.0845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4965 -10.0867 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7360 -10.7979 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3254 -11.5134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7398 -12.2268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
3 7 1 1
2 8 1 1
5 9 1 1
1 10 1 1
10 11 1 0
4 12 1 6
9 13 1 0
7 14 1 0
14 15 1 0
15 16 2 0
16 19 1 0
18 17 1 0
17 15 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
17 24 1 0
21 25 1 0
25 26 2 0
25 27 1 0
27 28 1 0
28 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 410.42Molecular Weight (Monoisotopic): 410.1689AlogP: -0.28#Rotatable Bonds: 7Polar Surface Area: 132.50Molecular Species: NEUTRALHBA: 10HBD: 3#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.28CX Basic pKa: 3.19CX LogP: 0.02CX LogD: 0.02Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.53Np Likeness Score: 0.32
References 1. Hassan M, van Klaveren S, Håkansson M, Diehl C, Kovačič R, Baussière F, Sundin AP, Dernovšek J, Walse B, Zetterberg F, Leffler H, Anderluh M, Tomašič T, Jakopin Ž, Nilsson UJ.. (2021) Benzimidazole-galactosides bind selectively to the Galectin-8 N-Terminal domain: Structure-based design and optimisation., 223 [PMID:34225180 ] [10.1016/j.ejmech.2021.113664 ]