The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(1-(4-bromophenylsulfonyl)-3-(4-(4-methylpiperazin-1-yl)phenyl)-4,5-dihydro-1H-pyrazol-5-yl)-N,N-dimethylaniline ID: ALA4846556
PubChem CID: 164609504
Max Phase: Preclinical
Molecular Formula: C28H32BrN5O2S
Molecular Weight: 582.57
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN1CCN(c2ccc(C3=NN(S(=O)(=O)c4ccc(Br)cc4)C(c4ccc(N(C)C)cc4)C3)cc2)CC1
Standard InChI: InChI=1S/C28H32BrN5O2S/c1-31(2)24-10-6-22(7-11-24)28-20-27(30-34(28)37(35,36)26-14-8-23(29)9-15-26)21-4-12-25(13-5-21)33-18-16-32(3)17-19-33/h4-15,28H,16-20H2,1-3H3
Standard InChI Key: OOGZXMNZWWURDU-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
3.8012 -26.4349 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5111 -26.0304 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.8058 -25.6179 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7358 -27.4688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3961 -27.9502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0592 -27.4724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8075 -26.6923 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9912 -26.6938 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8332 -27.7272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9996 -28.5284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7752 -28.7833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3851 -28.2381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2142 -27.4347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4388 -27.1834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9592 -27.7186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3535 -27.1682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5762 -27.4179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4034 -28.2175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0140 -28.7670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7889 -28.5144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6258 -28.4688 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0194 -27.9211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4546 -29.2679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1619 -28.4919 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3255 -29.2963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0982 -29.5509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7095 -29.0080 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5427 -28.2071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7645 -27.9490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4853 -29.2648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8449 -25.2860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6553 -25.2053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9891 -24.4617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5112 -23.7994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6956 -23.8855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3655 -24.6293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8445 -23.0533 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 4 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
6 9 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
4 15 1 0
18 21 1 0
21 22 1 0
21 23 1 0
12 24 1 0
8 2 1 0
24 25 1 0
24 29 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
27 30 1 0
2 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
34 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 582.57Molecular Weight (Monoisotopic): 581.1460AlogP: 4.81#Rotatable Bonds: 6Polar Surface Area: 59.46Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.83CX LogP: 5.34CX LogD: 4.77Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.42Np Likeness Score: -1.52
References 1. Chen CH, Jiang Y, Wu R, Tang Y, Wan C, Gao H, Mao Z.. (2021) Discovery of heterocyclic substituted dihydropyrazoles as potent anticancer agents., 48 [PMID:34214509 ] [10.1016/j.bmcl.2021.128233 ]