The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(3-(4-(1H-1,2,4-triazol-1-yl)phenyl)-5-(4-(dimethylamino)phenyl)-4,5-dihydro-1H-pyrazol-1-ylsulfonyl)benzonitrile ID: ALA4846639
PubChem CID: 164608816
Max Phase: Preclinical
Molecular Formula: C26H23N7O2S
Molecular Weight: 497.58
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)c1ccc(C2CC(c3ccc(-n4cncn4)cc3)=NN2S(=O)(=O)c2ccc(C#N)cc2)cc1
Standard InChI: InChI=1S/C26H23N7O2S/c1-31(2)22-9-7-21(8-10-22)26-15-25(20-5-11-23(12-6-20)32-18-28-17-29-32)30-33(26)36(34,35)24-13-3-19(16-27)4-14-24/h3-14,17-18,26H,15H2,1-2H3
Standard InChI Key: JZFQOQDIZFOALB-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
16.9381 -26.6289 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.6480 -26.2244 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
16.9428 -25.8119 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.8727 -27.6628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5331 -28.1442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1962 -27.6664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9445 -26.8863 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.1282 -26.8878 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.9702 -27.9212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1366 -28.7224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9122 -28.9773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5221 -28.4321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3511 -27.6286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5757 -27.3774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0961 -27.9125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4905 -27.3622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7132 -27.6119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5404 -28.4115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1509 -28.9610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9259 -28.7084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7628 -28.6628 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1563 -28.1150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5916 -29.4619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2988 -28.6859 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.9819 -25.4800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7922 -25.3993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1261 -24.6556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6481 -23.9933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8326 -24.0795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5025 -24.8233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9815 -23.2472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3120 -22.5003 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.5506 -29.4592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3678 -29.4606 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.6216 -28.6837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9613 -28.2024 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 4 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
6 9 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
4 15 1 0
18 21 1 0
21 22 1 0
21 23 1 0
12 24 1 0
8 2 1 0
2 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
28 31 1 0
31 32 3 0
24 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 24 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 497.58Molecular Weight (Monoisotopic): 497.1634AlogP: 3.74#Rotatable Bonds: 6Polar Surface Area: 107.48Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 4.82CX LogP: 3.87CX LogD: 3.87Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.40Np Likeness Score: -2.03
References 1. Chen CH, Jiang Y, Wu R, Tang Y, Wan C, Gao H, Mao Z.. (2021) Discovery of heterocyclic substituted dihydropyrazoles as potent anticancer agents., 48 [PMID:34214509 ] [10.1016/j.bmcl.2021.128233 ]