NA

ID: ALA4847100

PubChem CID: 154634335

Max Phase: Preclinical

Molecular Formula: C21H12O9

Molecular Weight: 408.32

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cccc(-c2c3oc(=O)c(C(=O)O)cc3cc3cc(C(=O)O)c(=O)oc23)c1

Standard InChI:  InChI=1S/C21H12O9/c1-28-12-4-2-3-9(6-12)15-16-10(7-13(18(22)23)20(26)29-16)5-11-8-14(19(24)25)21(27)30-17(11)15/h2-8H,1H3,(H,22,23)(H,24,25)

Standard InChI Key:  PCGUVDQXYAPRJC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   16.4385  -12.1821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4367  -10.5448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7304  -11.7732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7345  -10.9536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0308  -10.5425    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.3183  -10.9465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3142  -11.7661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0225  -12.1817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1453  -10.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1442  -11.7707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8503  -12.1797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5622  -11.7727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5634  -10.9520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8527  -10.5384    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.6133  -10.5334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.2721  -10.5451    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.2716  -12.1850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2693  -13.0022    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.9805  -11.7784    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.6015  -12.1735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8962  -11.7606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.5965  -12.9906    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.4303   -9.7298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1381   -9.3190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1352   -8.5026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4254   -8.0960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7170   -8.5117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7233   -9.3268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8416   -8.0916    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.5507   -8.4978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  1  1  0
  1 10  2  0
  9  2  2  0
  2  4  1  0
  3  4  2  0
  3  8  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  9 10  1  0
  9 14  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
  6 15  2  0
 13 16  2  0
 17 18  1  0
 17 19  2  0
 12 17  1  0
 20 21  1  0
 20 22  2  0
  7 20  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
  2 23  1  0
 25 29  1  0
 29 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4847100

    ---

Associated Targets(Human)

GPR35 Tchem G-protein coupled receptor 35 (2643 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 408.32Molecular Weight (Monoisotopic): 408.0481AlogP: 2.97#Rotatable Bonds: 4
Polar Surface Area: 144.25Molecular Species: ACIDHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 2.41CX Basic pKa: CX LogP: 2.26CX LogD: -4.73
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.38Np Likeness Score: 0.01

References

1. Wei L, Hou T, Li J, Zhang X, Zhou H, Wang Z, Cheng J, Xiang K, Wang J, Zhao Y, Liang X..  (2021)  Structure-Activity Relationship Studies of Coumarin-like Diacid Derivatives as Human G Protein-Coupled Receptor-35 (hGPR35) Agonists and a Consequent New Design Principle.,  64  (5.0): [PMID:33630609] [10.1021/acs.jmedchem.0c01624]

Source