3-Benzyl-4-oxo-10-oxa-3-aza-tricyclo[5.2.1.0(1,5)]dec-8-ene-6-carboxylic acid ((1R,4R)-1,7,7-trimethyl-bicyclo[2.2.1]hept-2-ylidene)-hydrazide

ID: ALA4847132

PubChem CID: 164608936

Max Phase: Preclinical

Molecular Formula: C26H31N3O3

Molecular Weight: 433.55

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1(C)[C@@H]2CC[C@@]1(C)/C(=N/NC(=O)C1C3C=CC4(CN(Cc5ccccc5)C(=O)C14)O3)C2

Standard InChI:  InChI=1S/C26H31N3O3/c1-24(2)17-9-11-25(24,3)19(13-17)27-28-22(30)20-18-10-12-26(32-18)15-29(23(31)21(20)26)14-16-7-5-4-6-8-16/h4-8,10,12,17-18,20-21H,9,11,13-15H2,1-3H3,(H,28,30)/b27-19+/t17-,18?,20?,21?,25+,26?/m1/s1

Standard InChI Key:  BWKXSLQPDYYSCE-WCSJQPKMSA-N

Molfile:  

 
     RDKit          2D

 33 38  0  0  0  0  0  0  0  0999 V2000
   31.6051   -3.1235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3997   -2.6695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6098   -2.2075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5094   -2.2659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0885   -2.2659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0885   -3.0899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8027   -3.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5127   -3.0899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8027   -1.8497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2246   -3.5029    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.9418   -3.0920    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.6537   -3.5050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6524   -4.3290    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.9074   -4.3145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3668   -3.0940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7975   -2.2802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0816   -1.8650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3644   -2.2741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1585   -2.4804    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.7920   -3.1045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0779   -3.5082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2438   -4.3089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0563   -4.4013    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.3933   -3.6534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4630   -5.1166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2954   -5.1221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7029   -5.8472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5345   -5.8530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9563   -5.1344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5404   -4.4083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7102   -4.4061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6826   -4.9237    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.8027   -1.0247    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  5  6  1  0
  5  9  1  0
  6  7  1  0
  7  8  1  0
  8  4  1  0
  4  9  1  0
  8 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
  9  2  1  0
  7  2  1  0
  7 14  1  1
 15 12  1  0
 15 21  1  0
 15 18  1  0
 20 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 20 19  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 20  1  0
 23 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 22 32  2  0
  9 33  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4847132

    ---

Associated Targets(Human)

HEK-293T (167025 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

MDCK (10148 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Orthohantavirus hantanense (22 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Vesicular stomatitis virus (4460 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 433.55Molecular Weight (Monoisotopic): 433.2365AlogP: 3.29#Rotatable Bonds: 4
Polar Surface Area: 71.00Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 11.80CX Basic pKa: 1.52CX LogP: 3.08CX LogD: 3.08
Aromatic Rings: 1Heavy Atoms: 32QED Weighted: 0.59Np Likeness Score: 0.00

References

1. Yarovaya OI, Kovaleva KS, Zaykovskaya AA, Yashina LN, Scherbakova NS, Scherbakov DN, Borisevich SS, Zubkov FI, Antonova AS, Peshkov RY, Eltsov IV, Pyankov OV, Maksyutov RA, Salakhutdinov NF..  (2021)  New class of hantaan virus inhibitors based on conjugation of the isoindole fragment to (+)-camphor or (-)-fenchone hydrazonesv.,  40  [PMID:33705902] [10.1016/j.bmcl.2021.127926]

Source