The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(5-(4-(dimethylamino)phenyl)-3-(4-(4-methylpiperazin-1-yl)phenyl)-4,5-dihydro-1H-pyrazol-1-ylsulfonyl)benzonitrile ID: ALA4847141
PubChem CID: 164608990
Max Phase: Preclinical
Molecular Formula: C29H32N6O2S
Molecular Weight: 528.68
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN1CCN(c2ccc(C3=NN(S(=O)(=O)c4ccc(C#N)cc4)C(c4ccc(N(C)C)cc4)C3)cc2)CC1
Standard InChI: InChI=1S/C29H32N6O2S/c1-32(2)25-10-8-24(9-11-25)29-20-28(23-6-12-26(13-7-23)34-18-16-33(3)17-19-34)31-35(29)38(36,37)27-14-4-22(21-30)5-15-27/h4-15,29H,16-20H2,1-3H3
Standard InChI Key: CVJMRJWJUWVRHC-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
27.5162 -27.3924 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.2261 -26.9879 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
27.5209 -26.5754 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.4508 -28.4263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1112 -28.9077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7743 -28.4299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5226 -27.6498 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.7063 -27.6513 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.5483 -28.6847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7147 -29.4859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4903 -29.7409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1002 -29.1956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9292 -28.3922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1538 -28.1410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6742 -28.6761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0686 -28.1258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2913 -28.3755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1184 -29.1751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7290 -29.7245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5040 -29.4719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3408 -29.4263 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.7344 -28.8786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1697 -30.2254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8769 -29.4494 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.0405 -30.2538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8133 -30.5084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4246 -29.9655 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.2577 -29.1646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4796 -28.9065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2004 -30.2223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5600 -26.2435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3703 -26.1628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7042 -25.4192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2262 -24.7569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4107 -24.8430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0805 -25.5868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5596 -24.0108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8901 -23.2639 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 4 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
6 9 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
4 15 1 0
18 21 1 0
21 22 1 0
21 23 1 0
12 24 1 0
8 2 1 0
24 25 1 0
24 29 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
27 30 1 0
2 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
34 37 1 0
37 38 3 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 528.68Molecular Weight (Monoisotopic): 528.2307AlogP: 3.92#Rotatable Bonds: 6Polar Surface Area: 83.25Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.83CX LogP: 4.43CX LogD: 3.86Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.48Np Likeness Score: -1.66
References 1. Chen CH, Jiang Y, Wu R, Tang Y, Wan C, Gao H, Mao Z.. (2021) Discovery of heterocyclic substituted dihydropyrazoles as potent anticancer agents., 48 [PMID:34214509 ] [10.1016/j.bmcl.2021.128233 ]