5-(7-fluoro-2-methyl-2H-indazol-5-yl)-2-(3-(3-methylpiperazin-1-yl)-1,2,4-triazin-6-yl)phenol

ID: ALA4847156

PubChem CID: 156887537

Max Phase: Preclinical

Molecular Formula: C22H22FN7O

Molecular Weight: 419.46

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC1CN(c2ncc(-c3ccc(-c4cc(F)c5nn(C)cc5c4)cc3O)nn2)CCN1

Standard InChI:  InChI=1S/C22H22FN7O/c1-13-11-30(6-5-24-13)22-25-10-19(26-27-22)17-4-3-14(9-20(17)31)15-7-16-12-29(2)28-21(16)18(23)8-15/h3-4,7-10,12-13,24,31H,5-6,11H2,1-2H3

Standard InChI Key:  YHFYLKGTHBSEFH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   14.5418   -1.7410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5418   -2.5660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2543   -2.9764    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.9668   -2.5660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9668   -1.7410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2543   -1.3265    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.2539   -3.8004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5372   -4.2102    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.5369   -5.0344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2524   -5.4497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9697   -5.0308    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.9666   -4.2080    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.2559   -6.2731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5397   -6.6839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5405   -7.5080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2566   -7.9224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9733   -7.5025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9691   -6.6796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8256   -1.3327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6824   -6.2664    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.2588   -8.7459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5433   -9.1576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5451   -9.9817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9725   -9.1515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9778   -9.9743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2658  -10.3962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4444  -11.2027    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.2669  -11.2808    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.5980  -10.5226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8313  -10.3983    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   16.6882  -11.9918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  3  7  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 10 13  1  0
  1 19  1  0
 18 20  1  0
 21 22  1  0
 22 23  2  0
 23 26  1  0
 25 24  1  0
 24 21  2  0
 16 21  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  1  0
 29 25  2  0
 23 30  1  0
 28 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4847156

    ---

Associated Targets(Human)

HTT Tchem Huntingtin (19182 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 419.46Molecular Weight (Monoisotopic): 419.1870AlogP: 2.74#Rotatable Bonds: 3
Polar Surface Area: 91.99Molecular Species: BASEHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 8.02CX Basic pKa: 8.83CX LogP: 2.13CX LogD: 1.76
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.53Np Likeness Score: -1.01

References

1. Sabnis RW..  (2021)  Novel Substituted Heteroaryl Compounds for Treating Huntington's Disease.,  12  (12.0): [PMID:34917244] [10.1021/acsmedchemlett.1c00607]

Source