10-(4-chlorophenyl)-7,8-dihydro-5H-indeno[1,2-b]quinoline-9,11(6H,10H)-dione

ID: ALA4847159

PubChem CID: 4139908

Max Phase: Preclinical

Molecular Formula: C22H16ClNO2

Molecular Weight: 361.83

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1CCCC2=C1C(c1ccc(Cl)cc1)C1=C(N2)c2ccccc2C1=O

Standard InChI:  InChI=1S/C22H16ClNO2/c23-13-10-8-12(9-11-13)18-19-16(6-3-7-17(19)25)24-21-14-4-1-2-5-15(14)22(26)20(18)21/h1-2,4-5,8-11,18,24H,3,6-7H2

Standard InChI Key:  VNCMKHPBMKAURP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 26 30  0  0  0  0  0  0  0  0999 V2000
    4.6530  -26.7085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6518  -27.5367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3673  -27.9499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0844  -27.5362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0816  -26.7049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3655  -26.2954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3615  -25.4753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3622  -23.8247    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0767  -24.2393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0765  -25.0612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7842  -25.4699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4966  -25.0615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4968  -24.2396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7846  -23.8263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6452  -25.0669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6430  -24.2389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8584  -25.3248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3698  -24.6564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8568  -23.9888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5221  -23.2355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7007  -23.1485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2151  -23.8209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5525  -24.5715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6054  -26.1109    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7828  -26.2957    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3671  -28.7757    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7 10  1  0
  7 15  1  0
  9  8  1  0
  8 16  1  0
  6  7  1  0
  9 10  2  0
  9 14  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 15 16  2  0
 16 19  1  0
 18 17  1  0
 17 15  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 17 24  2  0
 11 25  2  0
  3 26  1  0
M  END

Associated Targets(Human)

GPR174 Tchem Probable G-protein coupled receptor 174 (370 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 361.83Molecular Weight (Monoisotopic): 361.0870AlogP: 4.64#Rotatable Bonds: 1
Polar Surface Area: 46.17Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.51CX LogD: 3.51
Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.80Np Likeness Score: -0.71

References

1.  (2020)  Inhibitors of GPR174 and Uses Thereof, 
2.  (2020)  Methods and Compositions for Treating Cancer, 

Source