2-(6,8-diiodo-4-oxo-3-(4-sulfamoylphenyl)-3,4-dihydroquinazolin-2-ylthio)-N-(pyridin-3-yl)acetamide

ID: ALA4847585

PubChem CID: 164609943

Max Phase: Preclinical

Molecular Formula: C21H15I2N5O4S2

Molecular Weight: 719.32

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NS(=O)(=O)c1ccc(-n2c(SCC(=O)Nc3cccnc3)nc3c(I)cc(I)cc3c2=O)cc1

Standard InChI:  InChI=1S/C21H15I2N5O4S2/c22-12-8-16-19(17(23)9-12)27-21(33-11-18(29)26-13-2-1-7-25-10-13)28(20(16)30)14-3-5-15(6-4-14)34(24,31)32/h1-10H,11H2,(H,26,29)(H2,24,31,32)

Standard InChI Key:  SLVDFXBRNAXVPD-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
    7.6725   -8.6631    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0852   -9.3729    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.4937   -8.6606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4130  -10.9990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4119  -11.8186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1199  -12.2275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1181  -10.5902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8267  -10.9954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8256  -11.8206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5357  -12.2320    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2515  -11.8227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2527  -10.9975    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5380  -10.5816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7052  -10.5906    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0
    3.1196  -13.0447    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0
    4.5381   -9.7644    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9597  -10.5932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6667  -11.0052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3749  -10.5990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3773   -9.7810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6656   -9.3708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9603   -9.7793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9580  -12.2333    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.7927   -9.7826    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6669  -11.8267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3735  -12.2372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0823  -11.8306    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3712  -13.0544    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7889  -12.2412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7818  -13.0555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4875  -13.4660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1974  -13.0593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1971  -12.2379    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4908  -11.8311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  8 13  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
  4 14  1  0
  6 15  1  0
 13 16  2  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 12 17  1  0
 11 23  1  0
 20  2  1  0
  2 24  1  0
 23 25  1  0
 25 26  1  0
 26 27  1  0
 26 28  2  0
 27 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4847585

    ---

Associated Targets(non-human)

Nfe2l2 Nuclear factor erythroid 2-related factor 2 (714 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 719.32Molecular Weight (Monoisotopic): 718.8655AlogP: 3.37#Rotatable Bonds: 6
Polar Surface Area: 137.04Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.12CX Basic pKa: 4.38CX LogP: 3.88CX LogD: 3.88
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.18Np Likeness Score: -2.32

References

1. Soliman AM, Mekkawy MH, Karam HM, Higgins M, Dinkova-Kostova AT, Ghorab MM..  (2021)  Novel iodinated quinazolinones bearing sulfonamide as new scaffold targeting radiation induced oxidative stress.,  42  [PMID:33811990] [10.1016/j.bmcl.2021.128002]

Source