The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-chloro-2-methylthiophen-3-yl)-2-(6-(4-(2-hydroxyethyl)piperazin-1-yl)-2-methylpyrimidin-4-ylamino)thiazole-5-carboxamide ID: ALA4847716
PubChem CID: 148922714
Max Phase: Preclinical
Molecular Formula: C20H24ClN7O2S2
Molecular Weight: 494.05
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nc(Nc2ncc(C(=O)Nc3c(Cl)csc3C)s2)cc(N2CCN(CCO)CC2)n1
Standard InChI: InChI=1S/C20H24ClN7O2S2/c1-12-18(14(21)11-31-12)26-19(30)15-10-22-20(32-15)25-16-9-17(24-13(2)23-16)28-5-3-27(4-6-28)7-8-29/h9-11,29H,3-8H2,1-2H3,(H,26,30)(H,22,23,24,25)
Standard InChI Key: PKJTVQJCYWTEFT-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
33.3590 -2.5465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3578 -3.3660 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.0659 -3.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7755 -3.3655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7727 -2.5429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0641 -2.1376 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.0662 -4.5872 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.3566 -4.9944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3545 -5.8080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0602 -6.2206 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.7699 -5.8134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7737 -4.9936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6512 -2.1380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0570 -7.0378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3476 -7.4436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3443 -8.2608 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.4789 -2.1316 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.1881 -2.5375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2757 -3.3493 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.0757 -3.5162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4817 -2.8069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9325 -2.2018 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
38.2940 -2.7184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7769 -3.3776 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.5893 -3.2891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6235 -1.9706 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.1375 -3.8937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8827 -3.5585 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
40.7942 -2.7460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9942 -2.5793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6584 -1.8343 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
39.9705 -4.6937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 1 0
7 12 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
3 7 1 0
1 13 1 0
10 14 1 0
14 15 1 0
15 16 1 0
5 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 18 1 0
21 23 1 0
23 24 1 0
24 25 1 0
23 26 2 0
25 27 2 0
27 28 1 0
28 29 1 0
29 30 2 0
30 25 1 0
30 31 1 0
27 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 494.05Molecular Weight (Monoisotopic): 493.1121AlogP: 3.38#Rotatable Bonds: 7Polar Surface Area: 106.51Molecular Species: NEUTRALHBA: 10HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.51CX Basic pKa: 7.19CX LogP: 3.74CX LogD: 3.65Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.46Np Likeness Score: -2.25
References 1. (2020) Heterocyclic kinase inhibitors and uses thereof,