1-(4-(4-fluoro-5-(4-methylpiperidin-1-yl)-2-nitrophenyl)piperazin-1-yl)propan-1-one

ID: ALA4847967

PubChem CID: 2877494

Max Phase: Preclinical

Molecular Formula: C19H27FN4O3

Molecular Weight: 378.45

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCC(=O)N1CCN(c2cc(N3CCC(C)CC3)c(F)cc2[N+](=O)[O-])CC1

Standard InChI:  InChI=1S/C19H27FN4O3/c1-3-19(25)23-10-8-22(9-11-23)17-13-16(15(20)12-18(17)24(26)27)21-6-4-14(2)5-7-21/h12-14H,3-11H2,1-2H3

Standard InChI Key:  AMJZWDOOGCYVHS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
   30.0541  -10.3698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0530  -11.1972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7677  -11.6099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4841  -11.1967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4812  -10.3662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7659   -9.9571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3418  -11.6067    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.6279  -11.1915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9153  -11.5999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9104  -12.4252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6243  -12.8404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3432  -12.4303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3396   -9.9575    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   32.1991  -11.6080    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.1961  -12.4330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9071  -12.8443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6233  -12.4343    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.6240  -11.6084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9085  -11.1925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1962   -9.9497    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.1932   -9.1247    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.9122  -10.3594    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.3368  -12.8483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3349  -13.6733    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.0521  -12.4374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7656  -12.8515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1941  -12.8343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  1  0
  7 12  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
  2  7  1  0
  1 13  1  0
  4 14  1  0
 14 15  1  0
 14 19  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 20 21  2  0
 20 22  1  0
  5 20  1  0
 17 23  1  0
 23 24  2  0
 23 25  1  0
 25 26  1  0
 10 27  1  0
M  CHG  2  20   1  22  -1
M  END

Associated Targets(Human)

GPR174 Tchem Probable G-protein coupled receptor 174 (370 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 378.45Molecular Weight (Monoisotopic): 378.2067AlogP: 3.03#Rotatable Bonds: 4
Polar Surface Area: 69.93Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.18CX LogD: 3.18
Aromatic Rings: 1Heavy Atoms: 27QED Weighted: 0.59Np Likeness Score: -1.62

References

1.  (2020)  Inhibitors of GPR174 and Uses Thereof, 
2.  (2020)  Methods and Compositions for Treating Cancer, 

Source