10-(4-(trifluoromethoxy)phenyl)-7,8-dihydro-5H-indeno[1,2-b]quinoline-9,11(6H,10H)-dione

ID: ALA4847974

PubChem CID: 155088353

Max Phase: Preclinical

Molecular Formula: C23H16F3NO3

Molecular Weight: 411.38

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1CCCC2=C1C(c1ccc(OC(F)(F)F)cc1)C1=C(N2)c2ccccc2C1=O

Standard InChI:  InChI=1S/C23H16F3NO3/c24-23(25,26)30-13-10-8-12(9-11-13)18-19-16(6-3-7-17(19)28)27-21-14-4-1-2-5-15(14)22(29)20(18)21/h1-2,4-5,8-11,18,27H,3,6-7H2

Standard InChI Key:  JBGGULMILYTQIU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
   23.2929  -20.2237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2929  -18.5721    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.0056  -18.9892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0021  -19.8150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7116  -20.2287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4291  -19.8210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4326  -18.9953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7186  -18.5770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5802  -19.8151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5803  -18.9892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7948  -20.0701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3094  -19.4020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7954  -18.7356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4611  -17.9837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6411  -17.8970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1565  -18.5683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4934  -19.3176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2929  -21.0479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5765  -21.4610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5770  -22.2860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2932  -22.6990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0103  -22.2809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0062  -21.4572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7069  -21.0544    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.5396  -20.8555    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.2982  -23.5253    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.5854  -23.9425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5904  -24.7683    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   21.8679  -23.5338    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   21.8670  -24.3486    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
 10  2  1  0
  9  1  1  0
  1  4  1  0
  3  2  1  0
  3  4  2  0
  3  8  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  9 10  2  0
 10 13  1  0
 12 11  1  0
 11  9  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
  1 18  1  0
  5 24  2  0
 11 25  2  0
 21 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  1  0
 27 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4847974

    ---

Associated Targets(Human)

GPR174 Tchem Probable G-protein coupled receptor 174 (370 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 411.38Molecular Weight (Monoisotopic): 411.1082AlogP: 4.89#Rotatable Bonds: 2
Polar Surface Area: 55.40Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.34CX LogD: 4.34
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.76Np Likeness Score: -0.71

References

1.  (2020)  Inhibitors of GPR174 and Uses Thereof, 
2.  (2020)  Methods and Compositions for Treating Cancer, 

Source