The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
sodium 2,2'-(biphenyl-4,4'-diyl)bis(1-hydroxy-2-oxoethanesulfonate) ID: ALA484806
Cas Number: 2983-60-0
PubChem CID: 134521
Max Phase: Preclinical
Molecular Formula: C16H12Na2O10S2
Molecular Weight: 430.41
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(c1ccc(-c2ccc(C(=O)C(O)S(=O)(=O)[O-])cc2)cc1)C(O)S(=O)(=O)[O-].[Na+].[Na+]
Standard InChI: InChI=1S/C16H14O10S2.2Na/c17-13(15(19)27(21,22)23)11-5-1-9(2-6-11)10-3-7-12(8-4-10)14(18)16(20)28(24,25)26;;/h1-8,15-16,19-20H,(H,21,22,23)(H,24,25,26);;/q;2*+1/p-2
Standard InChI Key: QUKRUARISYJGLA-UHFFFAOYSA-L
Molfile:
RDKit 2D
30 29 0 0 0 0 0 0 0 0999 V2000
0.0000 -6.6000 0.0000 Na 0 0 0 0 0 15 0 0 0 0 0 0
-0.7145 1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7145 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7145 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7145 1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7145 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7145 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7145 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7145 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7145 3.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7145 3.3000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4289 2.8875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7145 4.1250 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.7145 4.9500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.1105 4.1250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5395 4.1250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7145 -3.3000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7145 -3.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4289 -2.8875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7145 -4.1250 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.7145 -4.9500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.5395 -4.1250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1105 -4.1250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7788 0.0000 0.0000 Na 0 0 0 0 0 15 0 0 0 0 0 0
6 7 2 0
14 15 1 0
7 2 1 0
14 16 2 0
15 17 1 0
3 4 1 0
15 18 1 0
8 9 2 0
18 19 1 0
18 20 2 0
9 10 1 0
18 21 2 0
4 5 2 0
11 22 1 0
10 11 2 0
22 23 2 0
22 24 1 0
11 12 1 0
24 25 1 0
5 6 1 0
24 26 1 0
12 13 2 0
26 27 1 0
13 8 1 0
26 28 2 0
4 8 1 0
26 29 2 0
2 3 2 0
7 14 1 0
M CHG 4 1 1 19 -1 27 -1 30 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 430.41Molecular Weight (Monoisotopic): 430.0028AlogP: 0.13#Rotatable Bonds: 7Polar Surface Area: 183.34Molecular Species: ACIDHBA: 8HBD: 4#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: -1.67CX Basic pKa: ┄CX LogP: 0.55CX LogD: -4.20Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.35Np Likeness Score: 0.02
References 1. Zhang L, Yan Y, Liu Z, Abliz Z, Liu G.. (2009) Identification of peptide substrate and small molecule inhibitors of testis-specific serine/threonine kinase1 (TSSK1) by the developed assays., 52 (14): [PMID:19530700 ] [10.1021/jm9002846 ]