The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(1-(3-Methoxy-4-(4-phenethylthiazol-2-yl)phenyl)-1H-1,2,3-triazol-4-yl)butan-1-ammonium 2,2,2-trifluoroacetate ID: ALA4848230
PubChem CID: 138691127
Max Phase: Preclinical
Molecular Formula: C26H28F3N5O3S
Molecular Weight: 433.58
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(-n2cc(CCCCN)nn2)ccc1-c1nc(CCc2ccccc2)cs1.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C24H27N5OS.C2HF3O2/c1-30-23-15-21(29-16-19(27-28-29)9-5-6-14-25)12-13-22(23)24-26-20(17-31-24)11-10-18-7-3-2-4-8-18;3-2(4,5)1(6)7/h2-4,7-8,12-13,15-17H,5-6,9-11,14,25H2,1H3;(H,6,7)
Standard InChI Key: FJPVKQMTPDNAIH-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 40 0 0 0 0 0 0 0 0999 V2000
17.0367 -16.1743 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.6303 -15.4653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2195 -16.1716 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17.3413 -15.0548 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.9194 -15.0548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2084 -15.4653 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.9194 -14.2339 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0844 -17.9853 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7557 -18.4637 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4222 -17.9785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1590 -17.1926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3349 -17.2006 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7599 -19.2862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0453 -19.7038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0490 -20.5281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7668 -20.9358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4822 -20.5173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4749 -19.6943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7750 -21.7626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1098 -22.2535 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.3685 -23.0368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1936 -23.0316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4463 -22.2451 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6405 -16.5206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4618 -16.6001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9434 -15.9280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7645 -16.0076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2419 -15.3355 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.2008 -20.9217 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9123 -20.5051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6846 -23.6967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3555 -24.4489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8423 -25.1140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5098 -25.8693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9959 -26.5340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6571 -25.0205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1493 -25.6821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8139 -26.4412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
2 4 1 0
2 5 1 0
5 6 1 0
5 7 2 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 8 2 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
9 13 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 19 2 0
16 19 1 0
11 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
17 29 1 0
29 30 1 0
22 31 1 0
31 32 1 0
32 33 1 0
33 34 2 0
34 35 1 0
35 38 2 0
37 36 2 0
36 33 1 0
37 38 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 433.58Molecular Weight (Monoisotopic): 433.1936AlogP: 4.47#Rotatable Bonds: 10Polar Surface Area: 78.85Molecular Species: BASEHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 10.21CX LogP: 4.79CX LogD: 2.19Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.37Np Likeness Score: -1.35
References 1. Revuelto A, de Lucio H, García-Soriano JC, Sánchez-Murcia PA, Gago F, Jiménez-Ruiz A, Camarasa MJ, Velázquez S.. (2021) Efficient Dimerization Disruption of Leishmania infantum Trypanothione Reductase by Triazole-phenyl-thiazoles., 64 (9.0): [PMID:33945281 ] [10.1021/acs.jmedchem.1c00206 ]