2-(4'-carbamimidoylbiphenyl-4-yl)-1-methyl-1H-benzo[d]imidazole-5-carboximidamide

ID: ALA4848233

PubChem CID: 164616628

Max Phase: Preclinical

Molecular Formula: C22H20N6

Molecular Weight: 368.44

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cn1c(-c2ccc(-c3ccc(C(=N)N)cc3)cc2)nc2cc(C(=N)N)ccc21

Standard InChI:  InChI=1S/C22H20N6/c1-28-19-11-10-17(21(25)26)12-18(19)27-22(28)16-8-4-14(5-9-16)13-2-6-15(7-3-13)20(23)24/h2-12H,1H3,(H3,23,24)(H3,25,26)

Standard InChI Key:  RSEIEOFGFALXDX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
   20.0053   -7.9060    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.2908   -7.4935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5764   -7.9060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5764   -8.7310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8619   -9.1435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8619   -7.4935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1474   -7.9060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1474   -8.7310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3628   -8.9860    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.1079   -9.7706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8779   -8.3185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0529   -8.3185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6404   -9.0330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8154   -9.0330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6404   -7.6041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8154   -7.6041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4029   -8.3185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5779   -8.3185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1654   -9.0330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3404   -9.0330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9279   -8.3185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1029   -8.3185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6904   -9.0330    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6904   -7.6041    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.3404   -7.6041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1654   -7.6041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3628   -7.6511    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.2908   -6.6685    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  3  6  2  0
  6  7  1  0
  7  8  2  0
  5  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 12 15  2  0
 15 16  1  0
 16 17  2  0
 14 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  1  0
 22 24  2  0
 21 25  1  0
 25 26  2  0
 18 26  1  0
 11 27  2  0
  7 27  1  0
  2 28  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4848233

    ---

Associated Targets(Human)

HOXA9 DNA binding site (122 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 368.44Molecular Weight (Monoisotopic): 368.1749AlogP: 3.48#Rotatable Bonds: 4
Polar Surface Area: 117.56Molecular Species: BASEHBA: 4HBD: 4
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 6#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 11.54CX LogP: 3.00CX LogD: -1.78
Aromatic Rings: 4Heavy Atoms: 28QED Weighted: 0.33Np Likeness Score: -0.69

References

1. Depauw S, Lambert M, Jambon S, Paul A, Peixoto P, Nhili R, Marongiu L, Figeac M, Dassi C, Paul-Constant C, Billoré B, Kumar A, Farahat AA, Ismail MA, Mineva E, Sweat DP, Stephens CE, Boykin DW, Wilson WD, David-Cordonnier MH..  (2019)  Heterocyclic Diamidine DNA Ligands as HOXA9 Transcription Factor Inhibitors: Design, Molecular Evaluation, and Cellular Consequences in a HOXA9-Dependant Leukemia Cell Model.,  62  (3.0): [PMID:30645099] [10.1021/acs.jmedchem.8b01448]

Source