The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Saccharochelin E ID: ALA4848278
PubChem CID: 164617740
Max Phase: Preclinical
Molecular Formula: C34H61N7O11
Molecular Weight: 743.90
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCCCCCCC(=O)N[C@@H](CCCN(O)C=O)C(=O)N[C@@H](CO)C(=O)N(O)CCC[C@@H]1NC(=O)[C@H](CCCN(O)C=O)NC1=O
Standard InChI: InChI=1S/C34H61N7O11/c1-2-3-4-5-6-7-8-9-10-11-12-19-30(45)35-26(16-13-20-39(50)24-43)31(46)38-29(23-42)34(49)41(52)22-15-18-28-33(48)36-27(32(47)37-28)17-14-21-40(51)25-44/h24-29,42,50-52H,2-23H2,1H3,(H,35,45)(H,36,48)(H,37,47)(H,38,46)/t26-,27-,28-,29-/m0/s1
Standard InChI Key: ZEZMMLAWSYXXQV-DZUOILHNSA-N
Molfile:
RDKit 2D
52 52 0 0 0 0 0 0 0 0999 V2000
8.7621 -20.0459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4739 -19.6374 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7621 -20.8673 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1858 -20.0459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8976 -19.6374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1858 -20.8673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4739 -21.2800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4739 -22.1013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1858 -22.5099 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1858 -23.3312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8976 -23.7439 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8976 -22.1013 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6094 -20.0459 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8976 -18.8160 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3213 -19.6374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0331 -20.0459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3213 -18.8160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0331 -18.4033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.7408 -19.6374 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.0331 -20.8673 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.7408 -18.8160 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.4527 -20.0459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1645 -19.6374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8763 -20.0459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5882 -19.6374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2955 -20.0466 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.0052 -19.6415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0094 -18.8199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2977 -18.4050 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5818 -18.8159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8693 -18.4043 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.7155 -20.0528 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.7228 -18.4098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7259 -17.5885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4351 -17.1826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1454 -17.5939 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.8588 -17.1879 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.1423 -18.4152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4290 -18.8252 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0549 -19.6365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3467 -20.0442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6395 -19.6347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9313 -20.0424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2241 -19.6329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5159 -20.0406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8087 -19.6311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1004 -20.0388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3932 -19.6293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6850 -20.0371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9778 -19.6276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2644 -20.0385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4486 -19.6293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
2 4 1 0
4 5 1 0
4 6 1 6
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
9 12 1 0
5 13 1 0
5 14 2 0
13 15 1 0
15 16 1 0
15 17 1 1
17 18 1 0
16 19 1 0
16 20 2 0
19 21 1 0
19 22 1 0
22 23 1 0
23 24 1 0
25 24 1 1
25 26 1 0
25 30 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 2 0
27 32 2 0
28 33 1 1
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
36 38 1 0
38 39 2 0
1 40 1 0
40 41 1 0
41 42 1 0
42 43 1 0
43 44 1 0
44 45 1 0
45 46 1 0
46 47 1 0
47 48 1 0
48 49 1 0
49 50 1 0
50 51 1 0
51 52 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 743.90Molecular Weight (Monoisotopic): 743.4429AlogP: 0.89#Rotatable Bonds: 31Polar Surface Area: 258.25Molecular Species: NEUTRALHBA: 11HBD: 8#RO5 Violations: 3HBA (Lipinski): 18HBD (Lipinski): 8#RO5 Violations (Lipinski): 3CX Acidic pKa: 7.93CX Basic pKa: ┄CX LogP: 0.02CX LogD: -0.10Aromatic Rings: ┄Heavy Atoms: 52QED Weighted: 0.02Np Likeness Score: 0.38
References 1. Shen Q, Dai G, Ravichandran V, Liu Y, Zhong L, Sui H, Ren X, Jiao N, Zhang Y, Zhou H, Bian X.. (2021) Saccharochelins A-H, Cytotoxic Amphiphilic Siderophores from the Rare Marine Actinomycete Saccharothrix sp. D09., 84 (8.0): [PMID:34323485 ] [10.1021/acs.jnatprod.1c00155 ]