The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3-(4-Chloro-3,5-dimethylphenoxy)propyl)-4-((4-ethylphenyl)sulfonyl)-3,5-dimethyl-1H-pyrrole-2-carboxylic acid ID: ALA4848433
PubChem CID: 161875282
Max Phase: Preclinical
Molecular Formula: C26H30ClNO5S
Molecular Weight: 504.05
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCc1ccc(S(=O)(=O)c2c(C)c(C(=O)O)n(CCCOc3cc(C)c(Cl)c(C)c3)c2C)cc1
Standard InChI: InChI=1S/C26H30ClNO5S/c1-6-20-8-10-22(11-9-20)34(31,32)25-18(4)24(26(29)30)28(19(25)5)12-7-13-33-21-14-16(2)23(27)17(3)15-21/h8-11,14-15H,6-7,12-13H2,1-5H3,(H,29,30)
Standard InChI Key: YCDMNFKHKZBRGK-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
4.0252 -9.3880 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6169 -8.6755 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.2040 -9.3854 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3235 -8.2479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0851 -8.5668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6231 -7.9412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1943 -7.2362 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3914 -7.4263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5125 -6.4751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0123 -5.8189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3305 -5.0577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8304 -4.4015 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1486 -3.6435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9642 -3.5444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2825 -2.7872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7849 -2.1323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9655 -2.2381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6510 -2.9954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4641 -1.5830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1027 -1.3742 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
7.1010 -2.6839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4454 -8.0087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7981 -8.7545 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9150 -7.3303 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8948 -8.2797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8819 -7.4545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1592 -7.0581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4530 -7.4865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4740 -8.3155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1972 -8.7082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2749 -9.3698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7660 -6.8882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7289 -7.0908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7096 -6.2661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 4 2 0
7 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
17 19 1 0
16 20 1 0
15 21 1 0
6 22 1 0
22 23 1 0
22 24 2 0
4 2 1 0
2 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
5 31 1 0
8 32 1 0
28 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 504.05Molecular Weight (Monoisotopic): 503.1533AlogP: 5.94#Rotatable Bonds: 9Polar Surface Area: 85.60Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.24CX Basic pKa: ┄CX LogP: 6.82CX LogD: 3.38Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.37Np Likeness Score: -1.16
References 1. Zhu PJ, Yu ZZ, Lv YF, Zhao JL, Tong YY, You QD, Jiang ZY.. (2021) Discovery of 3,5-Dimethyl-4-Sulfonyl-1H -Pyrrole-Based Myeloid Cell Leukemia 1 Inhibitors with High Affinity, Selectivity, and Oral Bioavailability., 64 (15.0): [PMID:34342996 ] [10.1021/acs.jmedchem.1c00682 ]