The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
10-(biphenyl-4-yl)-7,8-dihydro-5H-indeno[1,2-b]quinoline-9,11(6H,10H)-dione ID: ALA4848484
Cas Number: 700854-01-9
PubChem CID: 2950563
Max Phase: Preclinical
Molecular Formula: C28H21NO2
Molecular Weight: 403.48
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C1CCCC2=C1C(c1ccc(-c3ccccc3)cc1)C1=C(N2)c2ccccc2C1=O
Standard InChI: InChI=1S/C28H21NO2/c30-23-12-6-11-22-25(23)24(19-15-13-18(14-16-19)17-7-2-1-3-8-17)26-27(29-22)20-9-4-5-10-21(20)28(26)31/h1-5,7-10,13-16,24,29H,6,11-12H2
Standard InChI Key: FINOZFLXFJGKMG-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 36 0 0 0 0 0 0 0 0999 V2000
23.1053 -12.8750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1053 -11.2234 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.8180 -11.6404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8144 -12.4662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5238 -12.8799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2414 -12.4723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2449 -11.6465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5309 -11.2282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3925 -12.4662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3925 -11.6404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6071 -12.7213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1218 -12.0533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6077 -11.3869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2734 -10.6350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4534 -10.5482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9689 -11.2196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3058 -11.9688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1053 -13.6992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3889 -14.1122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3894 -14.9372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1056 -15.3502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8226 -14.9321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8186 -14.1085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5192 -13.7057 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.3520 -13.5067 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.1077 -16.1722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3918 -16.5862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3934 -17.4112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1102 -17.8232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8267 -17.4041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8215 -16.5805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10 2 1 0
9 1 1 0
1 4 1 0
3 2 1 0
3 4 2 0
3 8 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
9 10 2 0
10 13 1 0
12 11 1 0
11 9 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
1 18 1 0
5 24 2 0
11 25 2 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
21 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 403.48Molecular Weight (Monoisotopic): 403.1572AlogP: 5.66#Rotatable Bonds: 2Polar Surface Area: 46.17Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.56CX LogD: 4.56Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.60Np Likeness Score: -0.45
References 1. (2020) Inhibitors of GPR174 and Uses Thereof, 2. (2020) Methods and Compositions for Treating Cancer,