10-(biphenyl-4-yl)-7,8-dihydro-5H-indeno[1,2-b]quinoline-9,11(6H,10H)-dione

ID: ALA4848484

Cas Number: 700854-01-9

PubChem CID: 2950563

Max Phase: Preclinical

Molecular Formula: C28H21NO2

Molecular Weight: 403.48

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1CCCC2=C1C(c1ccc(-c3ccccc3)cc1)C1=C(N2)c2ccccc2C1=O

Standard InChI:  InChI=1S/C28H21NO2/c30-23-12-6-11-22-25(23)24(19-15-13-18(14-16-19)17-7-2-1-3-8-17)26-27(29-22)20-9-4-5-10-21(20)28(26)31/h1-5,7-10,13-16,24,29H,6,11-12H2

Standard InChI Key:  FINOZFLXFJGKMG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 36  0  0  0  0  0  0  0  0999 V2000
   23.1053  -12.8750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1053  -11.2234    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.8180  -11.6404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8144  -12.4662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5238  -12.8799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2414  -12.4723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2449  -11.6465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5309  -11.2282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3925  -12.4662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3925  -11.6404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6071  -12.7213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1218  -12.0533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6077  -11.3869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2734  -10.6350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4534  -10.5482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9689  -11.2196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3058  -11.9688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1053  -13.6992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3889  -14.1122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3894  -14.9372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1056  -15.3502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8226  -14.9321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8186  -14.1085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5192  -13.7057    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.3520  -13.5067    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.1077  -16.1722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3918  -16.5862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3934  -17.4112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1102  -17.8232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8267  -17.4041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8215  -16.5805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 10  2  1  0
  9  1  1  0
  1  4  1  0
  3  2  1  0
  3  4  2  0
  3  8  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  9 10  2  0
 10 13  1  0
 12 11  1  0
 11  9  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
  1 18  1  0
  5 24  2  0
 11 25  2  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 21 26  1  0
M  END

Associated Targets(Human)

GPR174 Tchem Probable G-protein coupled receptor 174 (370 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 403.48Molecular Weight (Monoisotopic): 403.1572AlogP: 5.66#Rotatable Bonds: 2
Polar Surface Area: 46.17Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 4.56CX LogD: 4.56
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.60Np Likeness Score: -0.45

References

1.  (2020)  Inhibitors of GPR174 and Uses Thereof, 
2.  (2020)  Methods and Compositions for Treating Cancer, 

Source