The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
19-Hydroxycytochalasin B ID: ALA4848578
PubChem CID: 164611042
Max Phase: Preclinical
Molecular Formula: C29H37NO6
Molecular Weight: 495.62
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=C1[C@@H](C)[C@H]2[C@H](Cc3ccccc3)NC(=O)[C@]23OC(=O)/C=C/[C@H](O)[C@H](O)CC[C@@H](C)C/C=C/[C@H]3[C@@H]1O
Standard InChI: InChI=1S/C29H37NO6/c1-17-8-7-11-21-27(34)19(3)18(2)26-22(16-20-9-5-4-6-10-20)30-28(35)29(21,26)36-25(33)15-14-24(32)23(31)13-12-17/h4-7,9-11,14-15,17-18,21-24,26-27,31-32,34H,3,8,12-13,16H2,1-2H3,(H,30,35)/b11-7+,15-14+/t17-,18+,21-,22-,23+,24-,26-,27+,29+/m0/s1
Standard InChI Key: FBVWDRPGQMSJGC-AAGUCFIISA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
4.5743 -3.0996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0020 -3.0996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2881 -2.6819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5720 -3.9307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9651 -4.4865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3061 -5.2354 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1238 -5.1424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1547 -4.3212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6064 -4.9406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7982 -4.7732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2501 -5.3918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5122 -6.1772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3274 -6.3407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8718 -5.7208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5309 -5.8568 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2881 -1.8548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8573 -2.6872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7681 -3.7096 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.7195 -2.6882 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0020 -3.9268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2861 -4.3326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1087 -5.4192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7114 -4.3392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7003 -5.1632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4045 -5.5825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4267 -3.9345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1353 -4.3585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1207 -5.1797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8207 -5.6007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5399 -5.2050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5545 -4.3838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8500 -3.9582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6938 -5.0463 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1032 -6.2452 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7131 -3.5091 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.8636 -3.1311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4072 -4.5886 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8048 -6.4277 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 4 1 0
1 3 1 0
20 2 1 0
2 3 1 0
21 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 21 1 0
5 8 1 1
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
7 15 2 0
3 16 2 0
1 17 1 6
4 18 1 1
2 19 1 1
20 21 1 0
20 23 1 0
22 24 1 0
23 26 2 0
24 25 2 0
25 28 1 0
27 26 1 0
27 32 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
21 33 1 1
22 33 1 0
22 34 2 0
20 35 1 1
32 36 1 6
28 37 1 6
29 38 1 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 495.62Molecular Weight (Monoisotopic): 495.2621AlogP: 2.46#Rotatable Bonds: 2Polar Surface Area: 116.09Molecular Species: NEUTRALHBA: 6HBD: 4#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.95CX Basic pKa: ┄CX LogP: 3.01CX LogD: 3.01Aromatic Rings: 1Heavy Atoms: 36QED Weighted: 0.37Np Likeness Score: 2.76
References 1. Hu XY, Wang CY, Li XM, Yang SQ, Li X, Wang BG, Si SY, Meng LH.. (2021) Cytochalasin Derivatives from the Endozoic Curvularia verruculosa CS-129, a Fungus Isolated from the Deep-Sea Squat Lobster Shinkaia crosnieri Living in the Cold Seep Environment., 84 (12.0): [PMID:34846891 ] [10.1021/acs.jnatprod.1c00907 ]