The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-((8-chloro-9-(3-methylpyridin-4-yl)-5-oxo-5,6-dihydro-[1,2,4]triazolo[1,5-c]quinazolin-2-yl)methylcarbamoyl)-2-(6-hydroxy-3-oxo-3H-xanthen-9-yl)benzoic acid ID: ALA4848599
PubChem CID: 164611058
Max Phase: Preclinical
Molecular Formula: C37H23ClN6O7
Molecular Weight: 699.08
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cnccc1-c1cc2c(cc1Cl)[nH]c(=O)n1nc(CNC(=O)c3ccc(-c4c5ccc(=O)cc-5oc5cc(O)ccc45)c(C(=O)O)c3)nc21
Standard InChI: InChI=1S/C37H23ClN6O7/c1-17-15-39-9-8-21(17)25-13-27-29(14-28(25)38)41-37(50)44-34(27)42-32(43-44)16-40-35(47)18-2-5-22(26(10-18)36(48)49)33-23-6-3-19(45)11-30(23)51-31-12-20(46)4-7-24(31)33/h2-15,45H,16H2,1H3,(H,40,47)(H,41,50)(H,48,49)
Standard InChI Key: OEIVDMIUXUREQM-UHFFFAOYSA-N
Molfile:
RDKit 2D
51 58 0 0 0 0 0 0 0 0999 V2000
13.5276 -27.4337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5265 -28.2532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2345 -28.6622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2327 -27.0248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9414 -27.4301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9402 -28.2552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6503 -28.6666 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.3661 -28.2573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0727 -28.6679 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.6502 -27.0158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3636 -27.3701 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9212 -26.8011 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5522 -26.0950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7668 -26.2278 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9157 -25.3631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8219 -27.0254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8185 -28.6612 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
12.8240 -26.2093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1191 -25.8011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4117 -26.2082 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4136 -27.0278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1191 -27.4323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5311 -25.7991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4636 -24.6824 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.8271 -23.9504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3750 -23.2697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6427 -23.8993 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.7433 -22.5394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2919 -21.8591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4754 -21.9099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1124 -22.6468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5659 -23.3240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6557 -21.1274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0240 -21.2348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1232 -19.8723 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2099 -21.2890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7611 -20.6070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9479 -20.6556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5826 -21.3855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0365 -22.0679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8481 -22.0159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7670 -21.4357 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.9393 -19.8242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3850 -20.5016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1900 -20.4546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5555 -19.7314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1098 -19.0540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2986 -19.0998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6492 -20.3101 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.4520 -21.3111 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.4772 -18.3241 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 11 1 0
8 9 2 0
10 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 10 2 0
13 15 1 0
1 16 1 0
2 17 1 0
16 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 16 1 0
18 23 1 0
15 24 1 0
24 25 1 0
25 26 1 0
25 27 2 0
26 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 26 1 0
29 33 1 0
34 44 2 0
34 36 1 0
43 35 1 0
35 37 1 0
30 34 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 36 1 0
39 42 1 0
43 44 1 0
43 48 2 0
44 45 1 0
45 46 2 0
46 47 1 0
47 48 1 0
33 49 2 0
33 50 1 0
47 51 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 699.08Molecular Weight (Monoisotopic): 698.1317AlogP: 5.81#Rotatable Bonds: 6Polar Surface Area: 192.78Molecular Species: ACIDHBA: 10HBD: 4#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 4#RO5 Violations (Lipinski): 3CX Acidic pKa: 3.54CX Basic pKa: 5.19CX LogP: 4.20CX LogD: 1.24Aromatic Rings: 6Heavy Atoms: 51QED Weighted: 0.15Np Likeness Score: -0.44
References 1. Rietz TA, Teuscher KB, Mills JJ, Gogliotti RD, Lepovitz LT, Scaggs WR, Yoshida K, Luong K, Lee T, Fesik SW.. (2021) Fragment-Based Discovery of Small Molecules Bound to T-Cell Immunoglobulin and Mucin Domain-Containing Molecule 3 (TIM-3)., 64 (19.0): [PMID:34597046 ] [10.1021/acs.jmedchem.1c01336 ]