The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2,5-Dimethyl-N-(4-((1-butyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)oxy)phenyl)benzenesulfonamide ID: ALA4848692
PubChem CID: 164614905
Max Phase: Preclinical
Molecular Formula: C27H27N5O3S
Molecular Weight: 501.61
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCc1nnc2c(Oc3ccc(NS(=O)(=O)c4cc(C)ccc4C)cc3)nc3ccccc3n12
Standard InChI: InChI=1S/C27H27N5O3S/c1-4-5-10-25-29-30-26-27(28-22-8-6-7-9-23(22)32(25)26)35-21-15-13-20(14-16-21)31-36(33,34)24-17-18(2)11-12-19(24)3/h6-9,11-17,31H,4-5,10H2,1-3H3
Standard InChI Key: NCKBFLCWNPAJQS-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
19.2293 -25.8798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6160 -18.9220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5060 -22.1688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6502 -22.5770 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.1512 -24.8935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1527 -23.5544 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.6399 -19.7442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9385 -24.6409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2276 -25.0548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9418 -26.2908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5085 -21.3438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7918 -20.9286 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.6519 -23.4019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6387 -24.2230 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.9369 -23.8159 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.6552 -25.0519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3195 -18.4888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2226 -22.5798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5890 -20.3114 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.6568 -25.8769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9363 -20.1774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0670 -19.7075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3685 -23.8130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0450 -18.8816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7886 -20.1000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
21.3702 -24.6380 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.9377 -22.1659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3653 -20.1370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9361 -21.3409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2194 -20.9256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4099 -25.6777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3719 -19.5126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.2100 -25.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7540 -25.2343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5541 -25.4006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7414 -18.4541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 7 2 0
8 9 1 0
17 2 1 0
11 3 2 0
13 15 2 0
26 23 1 0
5 31 1 0
19 25 2 0
22 24 1 0
23 13 1 0
10 20 2 0
27 18 2 0
30 29 2 0
14 6 1 0
7 28 1 0
27 4 1 0
18 3 1 0
15 8 1 0
24 17 2 0
26 16 1 0
12 11 1 0
14 5 2 0
29 27 1 0
25 32 2 0
22 28 2 0
25 12 1 0
9 1 2 0
11 30 1 0
26 5 1 0
8 16 2 0
20 16 1 0
1 10 1 0
23 6 2 0
7 21 1 0
4 13 1 0
22 25 1 0
31 33 1 0
33 34 1 0
34 35 1 0
24 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 501.61Molecular Weight (Monoisotopic): 501.1835AlogP: 5.83#Rotatable Bonds: 8Polar Surface Area: 98.48Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.09CX Basic pKa: 1.52CX LogP: 5.31CX LogD: 5.24Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.29Np Likeness Score: -1.85
References 1. Lee S, Lee S, Cil O, Diez-Cecilia E, Anderson MO, Verkman AS.. (2018) Nanomolar-Potency 1,2,4-Triazoloquinoxaline Inhibitors of the Kidney Urea Transporter UT-A1., 61 (7.0): [PMID:29589443 ] [10.1021/acs.jmedchem.8b00343 ]