2,5-Dimethyl-N-(4-((1-butyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)oxy)phenyl)benzenesulfonamide

ID: ALA4848692

PubChem CID: 164614905

Max Phase: Preclinical

Molecular Formula: C27H27N5O3S

Molecular Weight: 501.61

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCc1nnc2c(Oc3ccc(NS(=O)(=O)c4cc(C)ccc4C)cc3)nc3ccccc3n12

Standard InChI:  InChI=1S/C27H27N5O3S/c1-4-5-10-25-29-30-26-27(28-22-8-6-7-9-23(22)32(25)26)35-21-15-13-20(14-16-21)31-36(33,34)24-17-18(2)11-12-19(24)3/h6-9,11-17,31H,4-5,10H2,1-3H3

Standard InChI Key:  NCKBFLCWNPAJQS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   19.2293  -25.8798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6160  -18.9220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5060  -22.1688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6502  -22.5770    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.1512  -24.8935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1527  -23.5544    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.6399  -19.7442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9385  -24.6409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2276  -25.0548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9418  -26.2908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5085  -21.3438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7918  -20.9286    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.6519  -23.4019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6387  -24.2230    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.9369  -23.8159    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.6552  -25.0519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3195  -18.4888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2226  -22.5798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5890  -20.3114    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.6568  -25.8769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9363  -20.1774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0670  -19.7075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3685  -23.8130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0450  -18.8816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7886  -20.1000    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   21.3702  -24.6380    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.9377  -22.1659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3653  -20.1370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9361  -21.3409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2194  -20.9256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4099  -25.6777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3719  -19.5126    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.2100  -25.8440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7540  -25.2343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5541  -25.4006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7414  -18.4541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  7  2  0
  8  9  1  0
 17  2  1  0
 11  3  2  0
 13 15  2  0
 26 23  1  0
  5 31  1  0
 19 25  2  0
 22 24  1  0
 23 13  1  0
 10 20  2  0
 27 18  2  0
 30 29  2  0
 14  6  1  0
  7 28  1  0
 27  4  1  0
 18  3  1  0
 15  8  1  0
 24 17  2  0
 26 16  1  0
 12 11  1  0
 14  5  2  0
 29 27  1  0
 25 32  2  0
 22 28  2  0
 25 12  1  0
  9  1  2  0
 11 30  1  0
 26  5  1  0
  8 16  2  0
 20 16  1  0
  1 10  1  0
 23  6  2  0
  7 21  1  0
  4 13  1  0
 22 25  1  0
 31 33  1  0
 33 34  1  0
 34 35  1  0
 24 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4848692

    ---

Associated Targets(non-human)

Slc14a2 Urea transporter 2 (74 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 501.61Molecular Weight (Monoisotopic): 501.1835AlogP: 5.83#Rotatable Bonds: 8
Polar Surface Area: 98.48Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 8.09CX Basic pKa: 1.52CX LogP: 5.31CX LogD: 5.24
Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.29Np Likeness Score: -1.85

References

1. Lee S, Lee S, Cil O, Diez-Cecilia E, Anderson MO, Verkman AS..  (2018)  Nanomolar-Potency 1,2,4-Triazoloquinoxaline Inhibitors of the Kidney Urea Transporter UT-A1.,  61  (7.0): [PMID:29589443] [10.1021/acs.jmedchem.8b00343]

Source