The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(2-(5-(4-Butyl-1H-1,2,3-triazol-1-yl)-2-(4-(2-([1,1'-biphenyl]-4-yl)ethyl)thiazol-2-yl)phenoxy)ethyl)imidazolidin-2-one ID: ALA4848711
PubChem CID: 164615497
Max Phase: Preclinical
Molecular Formula: C34H36N6O2S
Molecular Weight: 592.77
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCc1cn(-c2ccc(-c3nc(CCc4ccc(-c5ccccc5)cc4)cs3)c(OCCN3CCNC3=O)c2)nn1
Standard InChI: InChI=1S/C34H36N6O2S/c1-2-3-9-28-23-40(38-37-28)30-16-17-31(32(22-30)42-21-20-39-19-18-35-34(39)41)33-36-29(24-43-33)15-12-25-10-13-27(14-11-25)26-7-5-4-6-8-26/h4-8,10-11,13-14,16-17,22-24H,2-3,9,12,15,18-21H2,1H3,(H,35,41)
Standard InChI Key: WISUUWHFKDZRID-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 48 0 0 0 0 0 0 0 0999 V2000
19.0859 -2.4392 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.7536 -2.9222 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.4207 -2.4324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1615 -1.6459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3366 -1.6538 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.7579 -3.7454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0468 -4.1592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0505 -4.9842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7648 -5.3965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4807 -4.9735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4735 -4.1498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7730 -6.2241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1114 -6.7112 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
19.3703 -7.4952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1962 -7.4900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4449 -6.7028 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.6435 -0.9733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4654 -1.0528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9432 -0.3844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7651 -0.4639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2000 -5.3823 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.9122 -4.9612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6314 -5.3700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3436 -4.9490 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.1014 -5.2739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6459 -4.6586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2289 -3.9464 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.4226 -4.1243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8032 -3.5756 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.6875 -8.1557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3540 -8.9126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8454 -9.5784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5085 -10.3343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9991 -10.9955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6608 -9.4847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1494 -10.1428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8178 -10.9026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3048 -11.5607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9749 -12.3144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4623 -12.9749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2797 -12.8830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6073 -12.1248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1179 -11.4674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 1 2 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
2 6 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 12 2 0
9 12 1 0
4 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
10 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 24 1 0
28 29 2 0
15 30 1 0
30 31 1 0
31 32 1 0
32 33 2 0
33 34 1 0
34 37 2 0
36 35 2 0
35 32 1 0
36 37 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 42 1 0
42 43 2 0
43 38 1 0
37 38 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 592.77Molecular Weight (Monoisotopic): 592.2620AlogP: 6.59#Rotatable Bonds: 13Polar Surface Area: 85.17Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.44CX Basic pKa: 2.21CX LogP: 6.95CX LogD: 6.95Aromatic Rings: 5Heavy Atoms: 43QED Weighted: 0.17Np Likeness Score: -1.47
References 1. Revuelto A, de Lucio H, García-Soriano JC, Sánchez-Murcia PA, Gago F, Jiménez-Ruiz A, Camarasa MJ, Velázquez S.. (2021) Efficient Dimerization Disruption of Leishmania infantum Trypanothione Reductase by Triazole-phenyl-thiazoles., 64 (9.0): [PMID:33945281 ] [10.1021/acs.jmedchem.1c00206 ]