The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-(4-(4-(4-(Ethylsulfonyl)piperazin-1-yl)-2-((1-methylpyrrolidin-2-yl)methoxy)thieno[2,3-d]pyrimidin-6-yl)phenyl)(4-methylpiperazin-1-yl)methanone ID: ALA4848735
PubChem CID: 164616092
Max Phase: Preclinical
Molecular Formula: C30H41N7O4S2
Molecular Weight: 627.84
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCS(=O)(=O)N1CCN(c2nc(OC[C@H]3CCCN3C)nc3sc(-c4ccc(C(=O)N5CCN(C)CC5)cc4)cc23)CC1
Standard InChI: InChI=1S/C30H41N7O4S2/c1-4-43(39,40)37-18-16-35(17-19-37)27-25-20-26(42-28(25)32-30(31-27)41-21-24-6-5-11-34(24)3)22-7-9-23(10-8-22)29(38)36-14-12-33(2)13-15-36/h7-10,20,24H,4-6,11-19,21H2,1-3H3/t24-/m1/s1
Standard InChI Key: BKCIAABLEPHERO-XMMPIXPASA-N
Molfile:
RDKit 2D
43 48 0 0 0 0 0 0 0 0999 V2000
30.1989 -10.2273 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.0203 -10.2273 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
30.6075 -9.5154 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.0203 -11.0486 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.3145 -11.4613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3145 -12.2826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0239 -12.6912 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.7333 -12.2826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7333 -11.4613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0239 -13.5117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3100 -13.9197 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.3100 -14.7403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0220 -15.1538 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.7331 -14.7345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7331 -13.9175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5085 -13.6608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9911 -14.3191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5179 -14.9802 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
33.8093 -14.3191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2265 -15.0255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0470 -15.0255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4514 -14.3047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0333 -13.5935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2141 -13.5935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7357 -9.8145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7357 -8.9932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2657 -14.2922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6850 -14.9936 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.6634 -13.5784 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.4817 -13.5692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8794 -12.8594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4635 -12.1555 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.6454 -12.1661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2433 -12.8804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8639 -11.4432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6018 -15.1479 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.8946 -14.7384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1864 -15.1461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4403 -14.8168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8927 -15.4234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3004 -16.1317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0999 -15.9627 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.7067 -16.5100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 2 1 0
5 4 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 4 1 0
7 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
15 14 2 0
15 10 1 0
16 15 1 0
17 16 2 0
18 17 1 0
14 18 1 0
17 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
2 25 1 0
25 26 1 0
22 27 1 0
27 28 2 0
27 29 1 0
29 30 1 0
29 34 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
32 35 1 0
12 36 1 0
36 37 1 0
38 37 1 6
38 39 1 0
39 40 1 0
40 41 1 0
41 42 1 0
42 38 1 0
42 43 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 627.84Molecular Weight (Monoisotopic): 627.2661AlogP: 2.69#Rotatable Bonds: 8Polar Surface Area: 102.42Molecular Species: BASEHBA: 10HBD: ┄#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 8.60CX LogP: 2.87CX LogD: 1.54Aromatic Rings: 3Heavy Atoms: 43QED Weighted: 0.37Np Likeness Score: -1.58
References 1. Li Y, Yang G, Zhang J, Tang P, Yang C, Wang G, Chen J, Liu J, Zhang L, Ouyang L.. (2021) Discovery, Synthesis, and Evaluation of Highly Selective Vascular Endothelial Growth Factor Receptor 3 (VEGFR3) Inhibitor for the Potential Treatment of Metastatic Triple-Negative Breast Cancer., 64 (16.0): [PMID:34351741 ] [10.1021/acs.jmedchem.1c00678 ]