The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(2-(5-(2-((2-aminoethylamino)methyl)-1H-imidazol-1-yl)-2-(4-(2-(naphthalen-2-yl)ethyl)thiazol-2-yl)phenoxy)ethyl)imidazolidin-2-one ID: ALA4848781
PubChem CID: 164617237
Max Phase: Preclinical
Molecular Formula: C32H35N7O2S
Molecular Weight: 581.75
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NCCNCc1nccn1-c1ccc(-c2nc(CCc3ccc4ccccc4c3)cs2)c(OCCN2CCNC2=O)c1
Standard InChI: InChI=1S/C32H35N7O2S/c33-11-12-34-21-30-35-14-16-39(30)27-9-10-28(29(20-27)41-18-17-38-15-13-36-32(38)40)31-37-26(22-42-31)8-6-23-5-7-24-3-1-2-4-25(24)19-23/h1-5,7,9-10,14,16,19-20,22,34H,6,8,11-13,15,17-18,21,33H2,(H,36,40)
Standard InChI Key: DHTSRULCJGSEII-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 47 0 0 0 0 0 0 0 0999 V2000
32.8298 -2.1033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5003 -2.5840 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.1659 -2.0964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9056 -1.3109 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.0815 -1.3189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5045 -3.4064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7906 -3.8220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7944 -4.6461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5115 -5.0558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2261 -4.6352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2188 -3.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5197 -5.8826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8554 -6.3718 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
33.1153 -7.1548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9403 -7.1495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1902 -6.3633 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.9517 -2.3476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5622 -1.7926 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.3480 -2.0437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9584 -1.4888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7442 -1.7399 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.9441 -5.0416 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.6551 -4.6230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3731 -5.0294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0839 -4.6107 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.8406 -4.9370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3874 -4.3192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9687 -3.6082 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.1633 -3.7868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5455 -3.2401 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.4296 -7.8138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2495 -7.7222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7388 -8.3865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4051 -9.1386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8935 -9.8025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5538 -8.2898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0443 -8.9506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7142 -9.7105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2069 -10.3742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0297 -10.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3574 -9.5149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8627 -8.8544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 1 2 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
2 6 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 12 2 0
9 12 1 0
3 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
10 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 25 1 0
29 30 2 0
15 31 1 0
31 32 1 0
32 33 1 0
33 34 2 0
34 35 1 0
35 38 2 0
37 36 2 0
36 33 1 0
37 38 1 0
38 39 1 0
39 40 2 0
40 41 1 0
41 42 2 0
42 37 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 581.75Molecular Weight (Monoisotopic): 581.2573AlogP: 4.39#Rotatable Bonds: 13Polar Surface Area: 110.33Molecular Species: BASEHBA: 8HBD: 3#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.49CX Basic pKa: 9.39CX LogP: 3.46CX LogD: 1.50Aromatic Rings: 5Heavy Atoms: 42QED Weighted: 0.18Np Likeness Score: -1.43
References 1. Revuelto A, de Lucio H, García-Soriano JC, Sánchez-Murcia PA, Gago F, Jiménez-Ruiz A, Camarasa MJ, Velázquez S.. (2021) Efficient Dimerization Disruption of Leishmania infantum Trypanothione Reductase by Triazole-phenyl-thiazoles., 64 (9.0): [PMID:33945281 ] [10.1021/acs.jmedchem.1c00206 ]