The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-fluoro-3-(5-(2-methoxypyrimidin-5-yl)-1H-pyrrolo[2,3-b]pyridine-3-carbonyl)phenyl)-1-phenylmethanesulfonamide ID: ALA4848804
PubChem CID: 146302404
Max Phase: Preclinical
Molecular Formula: C26H20FN5O4S
Molecular Weight: 517.54
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ncc(-c2cnc3[nH]cc(C(=O)c4cccc(NS(=O)(=O)Cc5ccccc5)c4F)c3c2)cn1
Standard InChI: InChI=1S/C26H20FN5O4S/c1-36-26-30-12-18(13-31-26)17-10-20-21(14-29-25(20)28-11-17)24(33)19-8-5-9-22(23(19)27)32-37(34,35)15-16-6-3-2-4-7-16/h2-14,32H,15H2,1H3,(H,28,29)
Standard InChI Key: VNUCFYAGMGVERJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
9.4200 -11.7697 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4241 -12.5946 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.1364 -12.1785 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4399 -12.9529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4387 -13.7802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1535 -14.1930 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1517 -12.5402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8670 -12.9493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8719 -13.7756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6592 -14.0264 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1412 -13.3550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6515 -12.6894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7254 -12.5406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7287 -11.7148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3025 -12.5445 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0168 -12.9529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9017 -11.9034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7077 -11.7271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3462 -11.2935 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2597 -12.3371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0650 -12.1614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3159 -11.3747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7556 -10.7635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9525 -10.9424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6202 -12.7715 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9814 -13.2057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2983 -11.7211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0144 -11.2983 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0080 -13.1227 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.7297 -13.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5808 -11.3140 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5747 -10.4892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9234 -14.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6718 -14.9524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2264 -15.5631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0326 -15.3882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2843 -14.6025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 8 1 0
4 13 1 0
13 14 2 0
14 28 1 0
27 15 1 0
15 16 2 0
16 13 1 0
12 17 1 0
17 18 1 0
17 19 2 0
18 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 18 1 0
21 25 1 0
25 2 1 0
2 26 1 0
27 28 2 0
20 29 1 0
26 30 1 0
27 31 1 0
31 32 1 0
30 33 1 0
30 37 2 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 517.54Molecular Weight (Monoisotopic): 517.1220AlogP: 4.34#Rotatable Bonds: 8Polar Surface Area: 126.93Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.57CX Basic pKa: 2.23CX LogP: 3.32CX LogD: 3.29Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.29Np Likeness Score: -1.16
References 1. Klövekorn P, Pfaffenrot B, Juchum M, Selig R, Albrecht W, Zender L, Laufer SA.. (2021) From off-to on-target: New BRAF-inhibitor-template-derived compounds selectively targeting mitogen activated protein kinase kinase 4 (MKK4)., 210 [PMID:33199152 ] [10.1016/j.ejmech.2020.112963 ]