Ethyl 4-(2-Chloro-N-(2-(cyclohexylamino)-1-(1H-indol-3-yl)-2-oxoethyl)acetamido)benzoate

ID: ALA4848813

PubChem CID: 164617782

Max Phase: Preclinical

Molecular Formula: C27H30ClN3O4

Molecular Weight: 496.01

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)c1ccc(N(C(=O)CCl)C(C(=O)NC2CCCCC2)c2c[nH]c3ccccc23)cc1

Standard InChI:  InChI=1S/C27H30ClN3O4/c1-2-35-27(34)18-12-14-20(15-13-18)31(24(32)16-28)25(26(33)30-19-8-4-3-5-9-19)22-17-29-23-11-7-6-10-21(22)23/h6-7,10-15,17,19,25,29H,2-5,8-9,16H2,1H3,(H,30,33)

Standard InChI Key:  VXKUUCJEVSTWBL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   22.1873  -15.1743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1861  -16.0014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9007  -16.4141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8989  -14.7616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6141  -15.1707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6190  -16.0014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4106  -16.2535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8950  -15.5785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4027  -14.9094    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.6677  -17.0341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1174  -17.6497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3738  -18.4297    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.1809  -18.6008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7314  -17.9852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4745  -17.1987    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.0235  -16.5832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4385  -19.3842    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   23.8240  -19.0445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3100  -17.4809    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.5385  -18.1548    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.8300  -16.7561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3786  -16.1414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1202  -15.3572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3080  -15.1914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7628  -15.8074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6683  -14.7409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4760  -14.9075    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.0241  -14.2911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8318  -14.4577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4086  -13.9582    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.0174  -18.8711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4686  -19.4819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7222  -20.2670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5300  -20.4379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0842  -19.8235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
 10 11  1  0
 10 15  1  0
 11 12  1  0
 13 14  1  0
 14 15  1  0
  7 10  1  0
 15 16  1  0
 13 17  1  0
 12 18  1  0
 11 19  2  0
 14 20  2  0
 16 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 16  1  0
 23 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 26 30  2  0
 18 31  1  0
 18 35  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4848813

    ---

Associated Targets(Human)

MCF7 (126967 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HT-1080 (3966 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
GPX4 Tchem Phospholipid hydroperoxide glutathione peroxidase (167 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

4T1 (1737 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 496.01Molecular Weight (Monoisotopic): 495.1925AlogP: 5.11#Rotatable Bonds: 8
Polar Surface Area: 91.50Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 4.70CX LogD: 4.70
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.34Np Likeness Score: -0.98

References

1. Xu C, Xiao Z, Wang J, Lai H, Zhang T, Guan Z, Xia M, Chen M, Ren L, He Y, Gao Y, Zhao C..  (2021)  Discovery of a Potent Glutathione Peroxidase 4 Inhibitor as a Selective Ferroptosis Inducer.,  64  (18.0): [PMID:34506134] [10.1021/acs.jmedchem.1c00569]

Source