The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Penicisteckin C ID: ALA4848872
PubChem CID: 164610512
Max Phase: Preclinical
Molecular Formula: C24H30O6
Molecular Weight: 414.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1c2c(c(C)c(O)c1-c1c(O)c(C)c3c(c1OC)CO[C@@H](C)C3)C[C@H](C)OC2
Standard InChI: InChI=1S/C24H30O6/c1-11-7-15-13(3)21(25)19(23(27-5)17(15)9-29-11)20-22(26)14(4)16-8-12(2)30-10-18(16)24(20)28-6/h11-12,25-26H,7-10H2,1-6H3/t11-,12-/m0/s1
Standard InChI Key: QPDJODIQIBXHFD-RYUDHWBXSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
4.5846 -10.3389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8691 -9.9298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5874 -11.1696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8697 -11.5840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8697 -12.4083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2975 -9.9237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0109 -10.3366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9995 -8.6864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2901 -9.1033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7207 -9.0961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7212 -9.9263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4366 -10.3386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1559 -9.9254 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1553 -9.0951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4355 -8.6782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0104 -11.1617 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7249 -11.5745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8667 -9.1047 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9936 -7.8614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8700 -8.6828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1561 -11.1701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1557 -10.3471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4467 -9.9383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7336 -10.3478 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7340 -11.1708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4475 -11.5841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3027 -11.5809 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5800 -8.6901 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1509 -8.6943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0192 -11.5829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21 4 1 0
3 1 1 0
1 2 2 0
2 22 1 0
3 4 2 0
4 5 1 0
1 6 1 0
6 7 2 0
7 11 1 0
10 8 1 0
8 9 2 0
9 6 1 0
10 11 2 0
10 15 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
7 16 1 0
16 17 1 0
2 18 1 0
9 28 1 0
8 19 1 0
14 20 1 6
21 22 2 0
21 26 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
3 27 1 0
18 29 1 0
25 30 1 6
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 414.50Molecular Weight (Monoisotopic): 414.2042AlogP: 4.32#Rotatable Bonds: 3Polar Surface Area: 77.38Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.97CX Basic pKa: ┄CX LogP: 4.39CX LogD: 4.38Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.78Np Likeness Score: 0.85
References 1. Wu XZ, Huang WJ, Liu W, Mándi A, Zhang Q, Zhang L, Zhang W, Kurtán T, Yuan CS, Zhang C.. (2021) Penicisteckins A-F, Isochroman-Derived Atropisomeric Dimers from Penicillium steckii HNNU-5B18., 84 (11.0): [PMID:34787427 ] [10.1021/acs.jnatprod.1c00787 ] 2. Wu XZ, Huang WJ, Liu W, Mándi A, Zhang Q, Zhang L, Zhang W, Kurtán T, Yuan CS, Zhang C.. (2021) Penicisteckins A-F, Isochroman-Derived Atropisomeric Dimers from Penicillium steckii HNNU-5B18., 84 (11.0): [PMID:34787427 ] [10.1021/acs.jnatprod.1c00787 ]