The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((4-Bromophenyl)sulfonyl)-1-(3-(4-chloro-3,5-dimethylphenoxy)propyl)-3,5-dimethy-1H-pyrrole-2-carboxylic acid ID: ALA4848900
PubChem CID: 161810867
Max Phase: Preclinical
Molecular Formula: C24H25BrClNO5S
Molecular Weight: 554.89
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(OCCCn2c(C)c(S(=O)(=O)c3ccc(Br)cc3)c(C)c2C(=O)O)cc(C)c1Cl
Standard InChI: InChI=1S/C24H25BrClNO5S/c1-14-12-19(13-15(2)21(14)26)32-11-5-10-27-17(4)23(16(3)22(27)24(28)29)33(30,31)20-8-6-18(25)7-9-20/h6-9,12-13H,5,10-11H2,1-4H3,(H,28,29)
Standard InChI Key: XTXZNIZKEYUMED-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
12.4351 -26.4828 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0267 -25.7702 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.6138 -26.4802 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7332 -25.3426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4951 -25.6615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0330 -25.0358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6041 -24.3308 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.8013 -24.5209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9223 -23.5696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4222 -22.9133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7404 -22.1521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2402 -21.4958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.5585 -20.7378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3742 -20.6386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6925 -19.8815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1947 -19.2265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3754 -19.3323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0609 -20.0897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8741 -18.6772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5127 -18.4684 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
15.5111 -19.7781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8553 -25.1034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2081 -25.8492 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3249 -24.4248 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3044 -25.3744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2915 -24.5491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5688 -24.1526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8626 -24.5810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8837 -25.4102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6070 -25.8029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6848 -26.4645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1758 -23.9828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1386 -24.1854 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 4 2 0
7 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
17 19 1 0
16 20 1 0
15 21 1 0
6 22 1 0
22 23 1 0
22 24 2 0
4 2 1 0
2 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
5 31 1 0
8 32 1 0
28 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 554.89Molecular Weight (Monoisotopic): 553.0325AlogP: 6.14#Rotatable Bonds: 8Polar Surface Area: 85.60Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.24CX Basic pKa: ┄CX LogP: 6.63CX LogD: 3.19Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.34Np Likeness Score: -1.19
References 1. Zhu PJ, Yu ZZ, Lv YF, Zhao JL, Tong YY, You QD, Jiang ZY.. (2021) Discovery of 3,5-Dimethyl-4-Sulfonyl-1H -Pyrrole-Based Myeloid Cell Leukemia 1 Inhibitors with High Affinity, Selectivity, and Oral Bioavailability., 64 (15.0): [PMID:34342996 ] [10.1021/acs.jmedchem.1c00682 ]