The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(5-(4-(dimethylamino)phenyl)-3-(4-(4-methylpiperazin-1-yl)phenyl)-4,5-dihydro-1H-pyrazol-1-yl)(p-tolyl)methanone ID: ALA4848922
PubChem CID: 164612101
Max Phase: Preclinical
Molecular Formula: C30H35N5O
Molecular Weight: 481.64
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(C(=O)N2N=C(c3ccc(N4CCN(C)CC4)cc3)CC2c2ccc(N(C)C)cc2)cc1
Standard InChI: InChI=1S/C30H35N5O/c1-22-5-7-25(8-6-22)30(36)35-29(24-11-13-26(14-12-24)32(2)3)21-28(31-35)23-9-15-27(16-10-23)34-19-17-33(4)18-20-34/h5-16,29H,17-21H2,1-4H3
Standard InChI Key: CAAVTLRHWQCGOJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
4.2116 -11.8184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8720 -12.2998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5351 -11.8220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2834 -11.0418 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4670 -11.0434 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3090 -12.0767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4755 -12.8779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2511 -13.1329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8609 -12.5877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6900 -11.7842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9146 -11.5330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4350 -12.0681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8294 -11.5178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0521 -11.7675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8792 -12.5671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4898 -13.1165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2648 -12.8639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1016 -12.8184 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4952 -12.2706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9305 -13.6174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6377 -12.8415 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9875 -10.3817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8013 -13.6459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5741 -13.9004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1853 -13.3576 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.0185 -12.5566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2404 -12.2985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9611 -13.6143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3207 -9.6355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1747 -10.4661 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1323 -9.5535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4656 -8.8082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9858 -8.1455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1691 -8.2330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8396 -8.9785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3181 -7.3989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 1 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
3 6 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
1 12 1 0
15 18 1 0
18 19 1 0
18 20 1 0
9 21 1 0
5 22 1 0
21 23 1 0
21 27 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
25 28 1 0
22 29 1 0
22 30 2 0
29 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 29 1 0
33 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 481.64Molecular Weight (Monoisotopic): 481.2842AlogP: 4.80#Rotatable Bonds: 5Polar Surface Area: 42.39Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.83CX LogP: 5.33CX LogD: 4.76Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.52Np Likeness Score: -1.50
References 1. Chen CH, Jiang Y, Wu R, Tang Y, Wan C, Gao H, Mao Z.. (2021) Discovery of heterocyclic substituted dihydropyrazoles as potent anticancer agents., 48 [PMID:34214509 ] [10.1016/j.bmcl.2021.128233 ]