The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(2-(5-(4-(4-aminobutyl)-1H-1,2,3-triazol-1-yl)-2-(4-neopentylthiazol-2-yl)phenoxy)ethyl)imidazolidin-2-one 2,2,2-trifluoroacetate ID: ALA4848972
PubChem CID: 138691093
Max Phase: Preclinical
Molecular Formula: C27H36F3N7O4S
Molecular Weight: 497.67
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)Cc1csc(-c2ccc(-n3cc(CCCCN)nn3)cc2OCCN2CCNC2=O)n1.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C25H35N7O2S.C2HF3O2/c1-25(2,3)15-19-17-35-23(28-19)21-8-7-20(32-16-18(29-30-32)6-4-5-9-26)14-22(21)34-13-12-31-11-10-27-24(31)33;3-2(4,5)1(6)7/h7-8,14,16-17H,4-6,9-13,15,26H2,1-3H3,(H,27,33);(H,6,7)
Standard InChI Key: MLBNDKGMKBSNDL-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 44 0 0 0 0 0 0 0 0999 V2000
34.4582 -25.5393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0402 -24.9615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2488 -24.7464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7864 -18.5593 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.4505 -19.0355 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.1098 -18.5525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8520 -17.7744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0357 -17.7823 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.4547 -19.8501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7474 -20.2617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7512 -21.0781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4615 -21.4839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1695 -21.0673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1622 -20.2523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4697 -22.3029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8117 -22.7874 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
34.0692 -23.5630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8864 -23.5578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1338 -22.7790 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.3272 -17.1096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1405 -17.1887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6157 -16.5239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4291 -16.6030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9043 -15.9381 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.8807 -21.4698 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.3710 -24.2158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5281 -25.6225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5848 -21.0552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2960 -21.4577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0002 -21.0430 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.7498 -21.3662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2913 -20.7542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8766 -20.0500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.0789 -20.2269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4668 -19.6854 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.9516 -17.6150 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
39.5471 -16.9093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1381 -17.6124 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
40.2548 -16.5007 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
38.8394 -16.5007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1317 -16.9093 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.8394 -15.6835 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 4 2 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
5 9 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 15 2 0
12 15 1 0
7 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
13 25 1 0
18 26 1 0
26 2 1 0
2 27 1 0
25 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 30 1 0
34 35 2 0
37 36 1 0
38 37 1 0
37 39 1 0
37 40 1 0
40 41 1 0
40 42 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 497.67Molecular Weight (Monoisotopic): 497.2573AlogP: 3.66#Rotatable Bonds: 11Polar Surface Area: 111.19Molecular Species: BASEHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.43CX Basic pKa: 10.20CX LogP: 3.21CX LogD: 0.61Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.39Np Likeness Score: -1.60
References 1. Revuelto A, de Lucio H, García-Soriano JC, Sánchez-Murcia PA, Gago F, Jiménez-Ruiz A, Camarasa MJ, Velázquez S.. (2021) Efficient Dimerization Disruption of Leishmania infantum Trypanothione Reductase by Triazole-phenyl-thiazoles., 64 (9.0): [PMID:33945281 ] [10.1021/acs.jmedchem.1c00206 ]