The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl 3-(3-(4-(1H-imidazol-1-yl)phenyl)-5-(4-(dimethylamino)phenyl)-4,5-dihydro-1H-pyrazol-1-yl)-3-oxopropanoate ID: ALA4849032
PubChem CID: 164615521
Max Phase: Preclinical
Molecular Formula: C24H25N5O3
Molecular Weight: 431.50
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)CC(=O)N1N=C(c2ccc(-n3ccnc3)cc2)CC1c1ccc(N(C)C)cc1
Standard InChI: InChI=1S/C24H25N5O3/c1-27(2)19-8-6-18(7-9-19)22-14-21(26-29(22)23(30)15-24(31)32-3)17-4-10-20(11-5-17)28-13-12-25-16-28/h4-13,16,22H,14-15H2,1-3H3
Standard InChI Key: UJJKQFATCJUSFQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
4.6285 -11.1085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2888 -11.5899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9519 -11.1121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7002 -10.3319 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8839 -10.3335 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7259 -11.3669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8923 -12.1680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6679 -12.4230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2778 -11.8778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1069 -11.0743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3314 -10.8231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8519 -11.3582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2462 -10.8079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4689 -11.0576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2961 -11.8572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9067 -12.4067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6816 -12.1541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5185 -12.1085 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.9121 -11.5607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3473 -12.9076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0546 -12.1316 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4043 -9.6718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7376 -8.9256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5915 -9.7563 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2580 -8.2640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5913 -7.5178 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4452 -8.3484 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1117 -6.8561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3063 -12.9049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9007 -12.9351 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3774 -12.1294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7170 -11.6481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 1 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
3 6 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
1 12 1 0
15 18 1 0
18 19 1 0
18 20 1 0
9 21 1 0
5 22 1 0
22 23 1 0
22 24 2 0
23 25 1 0
25 26 1 0
25 27 2 0
26 28 1 0
21 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 21 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 431.50Molecular Weight (Monoisotopic): 431.1957AlogP: 3.18#Rotatable Bonds: 6Polar Surface Area: 80.03Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.83CX Basic pKa: 6.08CX LogP: 2.81CX LogD: 2.79Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.44Np Likeness Score: -1.57
References 1. Chen CH, Jiang Y, Wu R, Tang Y, Wan C, Gao H, Mao Z.. (2021) Discovery of heterocyclic substituted dihydropyrazoles as potent anticancer agents., 48 [PMID:34214509 ] [10.1016/j.bmcl.2021.128233 ]