The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-2-(6-(5-chloro-2-((S)-1-hydroxypropan-2-ylamino)pyrimidin-4-yl)-1-oxoisoindolin-2-yl)-N-((S)-1-(3-fluoro-5-methoxyphenyl)-2-hydroxyethyl)propanamide ID: ALA4849148
PubChem CID: 129078139
Max Phase: Preclinical
Molecular Formula: C27H29ClFN5O5
Molecular Weight: 558.01
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(F)cc([C@@H](CO)NC(=O)[C@@H](C)N2Cc3ccc(-c4nc(N[C@@H](C)CO)ncc4Cl)cc3C2=O)c1
Standard InChI: InChI=1S/C27H29ClFN5O5/c1-14(12-35)31-27-30-10-22(28)24(33-27)16-4-5-17-11-34(26(38)21(17)8-16)15(2)25(37)32-23(13-36)18-6-19(29)9-20(7-18)39-3/h4-10,14-15,23,35-36H,11-13H2,1-3H3,(H,32,37)(H,30,31,33)/t14-,15+,23+/m0/s1
Standard InChI Key: NGTCYCHODXNDCZ-JIQFQSSQSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
8.3496 -17.0317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0661 -16.6183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0632 -15.7879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3478 -15.3787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6348 -16.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6361 -15.7899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8481 -15.5325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3598 -16.2025 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8461 -16.8737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7776 -17.0290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7775 -17.8550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4919 -18.2664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2066 -17.8527 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2027 -17.0234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4878 -16.6159 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.9150 -16.6073 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5348 -16.2013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1233 -15.4862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2983 -15.4850 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5369 -14.7724 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0633 -18.2679 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
6.5900 -17.6579 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8848 -16.1988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0598 -16.1976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2963 -16.9139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8828 -17.6277 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6526 -15.4813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8284 -15.4796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4141 -16.1941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8299 -16.9116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6528 -16.9096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4173 -14.7645 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.4189 -17.6268 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5939 -17.6286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1213 -16.9151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6316 -17.0162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3439 -16.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0605 -17.0088 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6358 -17.8411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
2 10 1 0
14 16 1 0
8 17 1 0
17 18 1 0
18 19 1 0
18 20 2 0
11 21 1 0
9 22 2 0
19 23 1 0
23 24 1 0
23 25 1 6
25 26 1 0
24 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 24 1 0
28 32 1 0
30 33 1 0
33 34 1 0
17 35 1 6
16 36 1 0
36 37 1 0
37 38 1 0
36 39 1 6
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 558.01Molecular Weight (Monoisotopic): 557.1841AlogP: 2.93#Rotatable Bonds: 10Polar Surface Area: 136.91Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.91CX Basic pKa: 3.14CX LogP: 2.16CX LogD: 2.16Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.30Np Likeness Score: -0.95
References 1. Heightman TD, Berdini V, Bevan L, Buck IM, Carr MG, Courtin A, Coyle JE, Day JEH, East C, Fazal L, Griffiths-Jones CM, Howard S, Kucia-Tran J, Martins V, Muench S, Munck JM, Norton D, O'Reilly M, Palmer N, Pathuri P, Peakman TM, Reader M, Rees DC, Rich SJ, Shah A, Wallis NG, Walton H, Wilsher NE, Woolford AJ, Cooke M, Cousin D, Onions S, Shannon J, Watts J, Murray CW.. (2021) Discovery of ASTX029, A Clinical Candidate Which Modulates the Phosphorylation and Catalytic Activity of ERK1/2., 64 (16.0): [PMID:34387469 ] [10.1021/acs.jmedchem.1c00905 ]