The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4849219
PubChem CID: 164613289
Max Phase: Preclinical
Molecular Formula: C33H38N2O5
Molecular Weight: 542.68
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2c(c1)OC(C)(C)C/C2=C1/CC(C)(C)Oc2cc(OCCCC(=O)NCc3ccccn3)ccc21
Standard InChI: InChI=1S/C33H38N2O5/c1-32(2)19-27(25-13-11-23(37-5)17-29(25)39-32)28-20-33(3,4)40-30-18-24(12-14-26(28)30)38-16-8-10-31(36)35-21-22-9-6-7-15-34-22/h6-7,9,11-15,17-18H,8,10,16,19-21H2,1-5H3,(H,35,36)/b28-27+
Standard InChI Key: AYRXLNVUVVTCHT-BYYHNAKLSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
5.2750 -13.2790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0749 -13.0665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4909 -12.4800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3290 -16.3707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5040 -16.3707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9165 -17.0851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6485 -15.5457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6473 -16.3730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3622 -16.7859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3604 -15.1329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0757 -15.5420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0745 -16.3705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7875 -16.7834 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5074 -15.5441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7899 -15.1265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7896 -14.3046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7953 -12.6557 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0753 -13.8946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5079 -13.0721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5057 -13.8897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2115 -14.2987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9201 -13.8911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9184 -13.0704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2119 -12.6650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9326 -16.7849 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2184 -16.3719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6319 -12.6562 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3473 -13.0669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0608 -12.6527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7762 -13.0635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4898 -12.6493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2051 -13.0600 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.4878 -11.8243 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.9187 -12.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6342 -13.0565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6323 -13.8801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3470 -14.2908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0615 -13.8765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0568 -13.0473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3416 -12.6403 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 4 1 0
6 5 1 0
7 8 2 0
8 9 1 0
9 12 2 0
11 10 2 0
10 7 1 0
11 12 1 0
11 15 1 0
12 13 1 0
13 5 1 0
5 14 1 0
14 15 1 0
16 20 1 0
16 18 1 0
19 17 1 0
17 2 1 0
2 18 1 0
15 16 2 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
8 25 1 0
25 26 1 0
23 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
31 33 2 0
32 34 1 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 542.68Molecular Weight (Monoisotopic): 542.2781AlogP: 6.60#Rotatable Bonds: 8Polar Surface Area: 78.91Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.44CX Basic pKa: 4.14CX LogP: 4.74CX LogD: 4.74Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.32Np Likeness Score: -0.50
References 1. Agarwal K, Gupta K, Sharma K, Khanka S, Singh S, Singh J, Trivedi L, Vasdev PG, Luqman S, Khan F, Singh D, Gupta A.. (2021) Synthesis and biological evaluation of substituted amide derivatives of C4-ageratochromene dimer analog., 50 [PMID:34469711 ] [10.1016/j.bmcl.2021.128340 ]