Ent-15-beta-((2,3-dimethoxybenzoyl)oxy)methyl-16-oxobeyeranbeyeran-19-oic acid

ID: ALA4849348

PubChem CID: 164617244

Max Phase: Preclinical

Molecular Formula: C30H40O7

Molecular Weight: 512.64

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cccc(C(=O)OC[C@@H]2C(=O)[C@@]3(C)CC[C@H]4[C@]5(C)CCC[C@@](C)(C(=O)O)[C@H]5CC[C@@]24C3)c1OC

Standard InChI:  InChI=1S/C30H40O7/c1-27-14-10-22-28(2)12-7-13-29(3,26(33)34)21(28)11-15-30(22,17-27)19(24(27)31)16-37-25(32)18-8-6-9-20(35-4)23(18)36-5/h6,8-9,19,21-22H,7,10-17H2,1-5H3,(H,33,34)/t19-,21+,22+,27+,28-,29-,30-/m1/s1

Standard InChI Key:  HAOAGNPWJFSUEL-NREKJJSKSA-N

Molfile:  

 
     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
   29.2409   -7.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8372   -8.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6420   -8.5366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5439   -6.6366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5439   -7.4414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2409   -6.2321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9338   -6.6366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9304   -7.4414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6242   -7.8466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3218   -7.4474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6311   -6.2370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3253   -6.6474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0248   -6.2512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0364   -5.4429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3422   -5.0325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6364   -5.4303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2425   -9.2365    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.4468   -8.5357    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.2290   -7.0369    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   30.6240   -7.0411    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   32.7410   -5.0516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9265   -5.8318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0149   -7.0493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7331   -5.8442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5112   -5.6412    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.3943   -7.7566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1987   -7.7843    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.5789   -8.4931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3832   -8.5208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1507   -9.1783    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.7570   -9.2337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5605   -9.2576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9896   -8.5760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6051   -7.8648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8028   -7.8402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4250   -7.1264    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.0314   -7.1787    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.8482   -6.4448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8358   -7.2043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  1
  1  3  1  0
  4  5  1  0
  4  6  1  0
  5  1  1  0
  1  8  1  0
  7  6  1  0
  7  8  1  0
  7 11  1  0
  8  9  1  0
  9 10  1  0
 10 12  1  0
 11 12  1  0
 11 16  1  0
 12 13  1  1
 13 14  1  0
 14 15  1  0
 15 16  1  0
  3 17  1  0
  3 18  2  0
  8 19  1  1
 11 20  1  1
 14 21  1  1
  7 22  1  6
 12 23  1  0
 14 24  1  0
 23 24  1  0
 24 25  2  0
 23 26  1  1
 26 27  1  0
 27 28  1  0
 28 29  1  0
 28 30  2  0
 29 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 29  1  0
 35 36  1  0
 34 37  1  0
 36 38  1  0
 37 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4849348

    ---

Associated Targets(non-human)

Danio rerio (3092 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 512.64Molecular Weight (Monoisotopic): 512.2774AlogP: 5.54#Rotatable Bonds: 6
Polar Surface Area: 99.13Molecular Species: ACIDHBA: 6HBD: 1
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 4.50CX Basic pKa: CX LogP: 5.94CX LogD: 3.14
Aromatic Rings: 1Heavy Atoms: 37QED Weighted: 0.50Np Likeness Score: 1.57

References

1. Zhang H, Liu B, Xu G, Xu C, Ou E, Liu J, Sun X, Zhao Y..  (2021)  Synthesis and in vivo screening of isosteviol derivatives as new cardioprotective agents.,  219  [PMID:33862515] [10.1016/j.ejmech.2021.113396]

Source