The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ent-15-beta-((2,3-dimethoxybenzoyl)oxy)methyl-16-oxobeyeranbeyeran-19-oic acid ID: ALA4849348
PubChem CID: 164617244
Max Phase: Preclinical
Molecular Formula: C30H40O7
Molecular Weight: 512.64
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc(C(=O)OC[C@@H]2C(=O)[C@@]3(C)CC[C@H]4[C@]5(C)CCC[C@@](C)(C(=O)O)[C@H]5CC[C@@]24C3)c1OC
Standard InChI: InChI=1S/C30H40O7/c1-27-14-10-22-28(2)12-7-13-29(3,26(33)34)21(28)11-15-30(22,17-27)19(24(27)31)16-37-25(32)18-8-6-9-20(35-4)23(18)36-5/h6,8-9,19,21-22H,7,10-17H2,1-5H3,(H,33,34)/t19-,21+,22+,27+,28-,29-,30-/m1/s1
Standard InChI Key: HAOAGNPWJFSUEL-NREKJJSKSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
29.2409 -7.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8372 -8.5375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6420 -8.5366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5439 -6.6366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5439 -7.4414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2409 -6.2321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9338 -6.6366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9304 -7.4414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6242 -7.8466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3218 -7.4474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6311 -6.2370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3253 -6.6474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0248 -6.2512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0364 -5.4429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3422 -5.0325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6364 -5.4303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2425 -9.2365 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.4468 -8.5357 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.2290 -7.0369 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
30.6240 -7.0411 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
32.7410 -5.0516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9265 -5.8318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0149 -7.0493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7331 -5.8442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5112 -5.6412 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.3943 -7.7566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1987 -7.7843 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.5789 -8.4931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3832 -8.5208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1507 -9.1783 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.7570 -9.2337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5605 -9.2576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9896 -8.5760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6051 -7.8648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8028 -7.8402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4250 -7.1264 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.0314 -7.1787 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.8482 -6.4448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8358 -7.2043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 1
1 3 1 0
4 5 1 0
4 6 1 0
5 1 1 0
1 8 1 0
7 6 1 0
7 8 1 0
7 11 1 0
8 9 1 0
9 10 1 0
10 12 1 0
11 12 1 0
11 16 1 0
12 13 1 1
13 14 1 0
14 15 1 0
15 16 1 0
3 17 1 0
3 18 2 0
8 19 1 1
11 20 1 1
14 21 1 1
7 22 1 6
12 23 1 0
14 24 1 0
23 24 1 0
24 25 2 0
23 26 1 1
26 27 1 0
27 28 1 0
28 29 1 0
28 30 2 0
29 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 29 1 0
35 36 1 0
34 37 1 0
36 38 1 0
37 39 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 512.64Molecular Weight (Monoisotopic): 512.2774AlogP: 5.54#Rotatable Bonds: 6Polar Surface Area: 99.13Molecular Species: ACIDHBA: 6HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.50CX Basic pKa: ┄CX LogP: 5.94CX LogD: 3.14Aromatic Rings: 1Heavy Atoms: 37QED Weighted: 0.50Np Likeness Score: 1.57
References 1. Zhang H, Liu B, Xu G, Xu C, Ou E, Liu J, Sun X, Zhao Y.. (2021) Synthesis and in vivo screening of isosteviol derivatives as new cardioprotective agents., 219 [PMID:33862515 ] [10.1016/j.ejmech.2021.113396 ]