The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4849357
PubChem CID: 155294431
Max Phase: Preclinical
Molecular Formula: C32H34N6O4S
Molecular Weight: 598.73
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C1Cc2cccc(c2)OCC/C=C/CCOc2cccc(c2)CC(=O)Nc2nnc(s2)CCCCc2ccc(nn2)N1
Standard InChI: InChI=1S/C32H34N6O4S/c39-29-21-23-9-7-12-26(19-23)41-17-5-1-2-6-18-42-27-13-8-10-24(20-27)22-30(40)34-32-38-37-31(43-32)14-4-3-11-25-15-16-28(33-29)36-35-25/h1-2,7-10,12-13,15-16,19-20H,3-6,11,14,17-18,21-22H2,(H,33,36,39)(H,34,38,40)/b2-1+
Standard InChI Key: IFQQSJCIINHYQE-OWOJBTEDSA-N
Molfile:
RDKit 2D
43 47 0 0 0 0 0 0 0 0999 V2000
9.5055 -12.3413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2965 -11.5627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5024 -11.3531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9412 -11.9130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1548 -12.7059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9320 -12.9159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5310 -8.0731 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.3164 -8.8614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9998 -9.3091 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.6368 -8.7934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3429 -8.0336 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4171 -9.0410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0137 -8.4902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7857 -8.7338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3865 -8.1830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1626 -8.4224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3434 -9.2115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1228 -9.4510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7245 -8.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5332 -8.0981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.7583 -7.8664 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.5092 -9.1259 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.6980 -9.9199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4826 -10.1541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6714 -10.9482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0787 -11.5087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0523 -12.5329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6452 -11.9765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4581 -11.1811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2972 -10.5767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5115 -10.3630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0999 -9.6567 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0011 -11.0083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.2625 -12.2909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1021 -10.4756 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2872 -12.5546 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4950 -13.3449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2834 -13.5601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8639 -12.9849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6523 -13.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2327 -12.6249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0211 -12.8400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6016 -12.2648 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 1 0
10 11 2 0
11 7 1 0
10 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
19 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 2 0
26 34 1 0
34 27 2 0
27 28 1 0
28 29 2 0
29 25 1 0
3 30 1 0
30 31 1 0
31 32 1 0
31 33 2 0
8 32 1 0
23 35 2 0
1 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 2 0
40 41 1 0
41 42 1 0
42 43 1 0
43 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 598.73Molecular Weight (Monoisotopic): 598.2362AlogP: 5.36#Rotatable Bonds: ┄Polar Surface Area: 128.22Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 6.95CX Basic pKa: 1.89CX LogP: 4.76CX LogD: 4.23Aromatic Rings: 4Heavy Atoms: 43QED Weighted: 0.26Np Likeness Score: 0.59
References 1. Xu X, Wang J, Wang M, Yuan X, Li L, Zhang C, Huang H, Jing T, Wang C, Tong C, Zhou L, Meng Y, Xu P, Kou J, Qiu Z, Li Z, Bian J.. (2021) Structure-Enabled Discovery of Novel Macrocyclic Inhibitors Targeting Glutaminase 1 Allosteric Binding Site., 64 (8.0): [PMID:33792311 ] [10.1021/acs.jmedchem.0c02044 ]