The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-epi-withanolide D ID: ALA4849546
PubChem CID: 164614948
Max Phase: Preclinical
Molecular Formula: C28H38O6
Molecular Weight: 470.61
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC1=C(C)C(=O)O[C@@H]([C@](C)(O)[C@H]2CC[C@H]3[C@@H]4C[C@H]5O[C@]56C(O)C=CC(=O)[C@]6(C)[C@H]4CC[C@]23C)C1
Standard InChI: InChI=1S/C28H38O6/c1-14-12-22(33-24(31)15(14)2)27(5,32)19-7-6-17-16-13-23-28(34-23)21(30)9-8-20(29)26(28,4)18(16)10-11-25(17,19)3/h8-9,16-19,21-23,30,32H,6-7,10-13H2,1-5H3/t16-,17-,18-,19-,21?,22+,23+,25-,26-,27+,28+/m0/s1
Standard InChI Key: SASUFNRGCZMRFD-VCVOSADASA-N
Molfile:
RDKit 2D
40 45 0 0 0 0 0 0 0 0999 V2000
31.6770 -13.0217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4770 -13.2383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2647 -12.4371 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.2887 -12.2519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2887 -13.0770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0008 -13.4853 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.7129 -13.0770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7129 -12.2519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0008 -11.8353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8601 -16.3094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5721 -16.7177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5721 -15.0676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2842 -15.4843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7063 -16.3154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9965 -15.0725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7059 -15.4929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7229 -13.8465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0018 -14.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4323 -14.2669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4234 -15.0885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2020 -15.3509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6922 -14.6915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2165 -14.0216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9895 -16.7226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2821 -16.3153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2831 -17.1316 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.5721 -14.2426 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.2768 -14.6593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6977 -14.6675 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
31.4270 -13.4383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9894 -15.8968 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
31.4186 -15.9135 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
33.0396 -14.0175 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
35.4268 -13.4905 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.4286 -11.8415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0008 -11.0102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9980 -12.6591 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
30.3977 -17.4344 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
27.8577 -15.4843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5701 -17.5427 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 1
4 5 1 0
4 9 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
39 12 1 0
10 11 1 0
11 25 1 0
13 12 1 0
13 25 1 0
13 15 1 0
24 14 1 0
14 16 1 0
15 16 1 0
15 18 1 0
16 20 1 0
19 17 1 0
17 18 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 19 1 0
23 2 1 0
2 5 1 0
25 24 1 0
25 26 1 1
24 26 1 0
12 27 2 0
13 28 1 1
16 29 1 1
19 30 1 1
15 31 1 6
20 32 1 6
23 33 1 6
7 34 2 0
8 35 1 0
9 36 1 0
5 37 1 6
24 38 1 6
10 39 2 0
11 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 470.61Molecular Weight (Monoisotopic): 470.2668AlogP: 3.50#Rotatable Bonds: 2Polar Surface Area: 96.36Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.29CX Basic pKa: ┄CX LogP: 3.78CX LogD: 3.78Aromatic Rings: ┄Heavy Atoms: 34QED Weighted: 0.47Np Likeness Score: 3.79
References 1. Freitas Misakyan MF, Wijeratne EMK, Issa ME, Xu YM, Monteillier A, Gunatilaka AAL, Cuendet M.. (2021) Structure-Activity Relationships of Withanolides as Antiproliferative Agents for Multiple Myeloma: Comparison of Activity in 2D Models and a 3D Coculture Model., 84 (8.0): [PMID:34445874 ] [10.1021/acs.jnatprod.1c00446 ]