The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-((4-(Acrylaminomethyl)benzyl)amino)-7-((3,5-dimethoxyphenyl)amino)imidazo[1,2-c]pyrimidine-8-carboxamide ID: ALA4849602
PubChem CID: 164617256
Max Phase: Preclinical
Molecular Formula: C26H27N7O4
Molecular Weight: 501.55
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)NCc1ccc(CNc2nc(Nc3cc(OC)cc(OC)c3)c(C(N)=O)c3nccn23)cc1
Standard InChI: InChI=1S/C26H27N7O4/c1-4-21(34)29-14-16-5-7-17(8-6-16)15-30-26-32-24(22(23(27)35)25-28-9-10-33(25)26)31-18-11-19(36-2)13-20(12-18)37-3/h4-13,31H,1,14-15H2,2-3H3,(H2,27,35)(H,29,34)(H,30,32)
Standard InChI Key: UYEKNTPZCGEEDX-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
13.0794 -2.5250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0794 -3.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7914 -3.7584 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.5034 -3.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7914 -2.1084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5003 -2.5233 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.1140 -1.9772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7843 -1.2248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9670 -1.3059 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.2180 -3.7623 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.2183 -4.5873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9330 -4.9995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3637 -2.1146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3613 -1.2896 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6504 -2.5292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3655 -3.7636 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.3666 -4.5886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6514 -4.9999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6522 -5.8241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3679 -6.2364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0841 -5.8184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0798 -4.9955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8007 -6.2274 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8047 -7.0524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9382 -6.2373 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9390 -7.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9311 -5.8220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6448 -6.2341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3602 -5.8213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3572 -4.9920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6428 -4.5836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0754 -6.2326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0768 -7.0576 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.7920 -7.4688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7934 -8.2938 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.5058 -7.0551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2209 -7.4664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
1 5 1 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 2 0
4 10 1 0
10 11 1 0
11 12 1 0
1 13 1 0
13 14 1 0
13 15 2 0
2 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
21 23 1 0
23 24 1 0
19 25 1 0
25 26 1 0
12 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 12 1 0
29 32 1 0
32 33 1 0
33 34 1 0
34 35 2 0
34 36 1 0
36 37 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 501.55Molecular Weight (Monoisotopic): 501.2125AlogP: 3.00#Rotatable Bonds: 11Polar Surface Area: 144.90Molecular Species: NEUTRALHBA: 9HBD: 4#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.71CX Basic pKa: 5.10CX LogP: 3.01CX LogD: 3.01Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.23Np Likeness Score: -0.96
References 1. Rao D, Li H, Ren X, Sun Y, Wen C, Zheng M, Huang H, Tang W, Xu S.. (2021) Discovery of a potent, selective, and covalent ZAP-70 kinase inhibitor., 219 [PMID:33845236 ] [10.1016/j.ejmech.2021.113393 ]