4-(2-(6-cyanoquinazolin-4-ylamino)ethyl)-N-methylbenzamide

ID: ALA4849615

PubChem CID: 71679497

Max Phase: Preclinical

Molecular Formula: C19H17N5O

Molecular Weight: 331.38

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CNC(=O)c1ccc(CCNc2ncnc3ccc(C#N)cc23)cc1

Standard InChI:  InChI=1S/C19H17N5O/c1-21-19(25)15-5-2-13(3-6-15)8-9-22-18-16-10-14(11-20)4-7-17(16)23-12-24-18/h2-7,10,12H,8-9H2,1H3,(H,21,25)(H,22,23,24)

Standard InChI Key:  SHPYROLQIGKYOP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
    3.5480   -6.3229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5469   -7.1424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2549   -7.5514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2531   -5.9140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9617   -6.3193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9606   -7.1399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6668   -7.5490    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3786   -7.1419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3798   -6.3213    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6691   -5.9077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8407   -5.9149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1329   -5.5065    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6691   -5.0905    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3768   -4.6819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3768   -3.8647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0845   -3.4561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7893   -3.8688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4965   -3.4609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4969   -2.6428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7843   -2.2344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0800   -2.6446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2041   -2.2333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9124   -2.6410    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.2031   -1.4161    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.6195   -2.2314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 11 12  3  0
  1 11  1  0
 10 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 19 22  1  0
 22 23  1  0
 22 24  2  0
 23 25  1  0
M  END

Associated Targets(Human)

CDK1 Tchem Cyclin-dependent kinase 1 (3927 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 331.38Molecular Weight (Monoisotopic): 331.1433AlogP: 2.52#Rotatable Bonds: 5
Polar Surface Area: 90.70Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.62CX LogP: 2.44CX LogD: 2.44
Aromatic Rings: 3Heavy Atoms: 25QED Weighted: 0.75Np Likeness Score: -1.43

References

1.  (2019)  Cdk8/cdk19 selective inhibitors and their use in anti-metastatic and chemopreventive methods for cancer, 

Source