2,6-difluoro-4-(9-(4-(2-morpholinoethyl)phenyl)-9H-purin-2-ylamino)phenol

ID: ALA4849660

PubChem CID: 164611094

Max Phase: Preclinical

Molecular Formula: C23H22F2N6O2

Molecular Weight: 452.47

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Oc1c(F)cc(Nc2ncc3ncn(-c4ccc(CCN5CCOCC5)cc4)c3n2)cc1F

Standard InChI:  InChI=1S/C23H22F2N6O2/c24-18-11-16(12-19(25)21(18)32)28-23-26-13-20-22(29-23)31(14-27-20)17-3-1-15(2-4-17)5-6-30-7-9-33-10-8-30/h1-4,11-14,32H,5-10H2,(H,26,28,29)

Standard InChI Key:  UWGYODGLBGTABR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   37.7509   -3.7873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7498   -4.6146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4645   -5.0274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1810   -4.6142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1780   -3.7836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4627   -3.3746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4603   -2.5496    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   37.0364   -3.3750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.0349   -5.0265    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   39.8960   -5.0255    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.6098   -4.6119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.3215   -5.0237    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.3138   -3.3738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6036   -3.7890    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.0308   -3.7787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.0377   -4.6069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.8358   -4.8771    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.3087   -4.1822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.8163   -3.5162    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.0976   -5.6574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.5496   -6.2754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.8111   -7.0571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.6204   -7.2217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.1676   -6.5986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.9031   -5.8195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.8836   -8.0036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.3381   -8.6224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.6013   -9.4043    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.0512  -10.0197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.3115  -10.7987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.1196  -10.9660    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.6672  -10.3476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.4067   -9.5621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  1  8  1  0
  2  9  1  0
  4 10  1  0
 10 11  1  0
 11 12  2  0
 12 16  1  0
 15 13  1  0
 13 14  2  0
 14 11  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 15  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 17 20  1  0
 23 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 28 33  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4849660

    ---

Associated Targets(Human)

RPS6KA3 Tchem Ribosomal protein S6 kinase alpha 3 (4284 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 452.47Molecular Weight (Monoisotopic): 452.1772AlogP: 3.42#Rotatable Bonds: 6
Polar Surface Area: 88.33Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 8.34CX Basic pKa: 7.40CX LogP: 3.41CX LogD: 3.31
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.43Np Likeness Score: -1.41

References

1. Casalvieri KA, Matheson CJ, Warfield BM, Backos DS, Reigan P..  (2021)  N-Substituted pyrrolopyrimidines and purines as p90 ribosomal S6 protein kinase-2 (RSK2) inhibitors.,  41  [PMID:34034149] [10.1016/j.bmc.2021.116220]

Source