7-((3,5-Dimethoxyphenyl)amino)-5-((3-propionamidobenzyl)amino)imidazo[1,2-c]pyrimidine-8-carboxamide

ID: ALA4849832

PubChem CID: 164610552

Max Phase: Preclinical

Molecular Formula: C25H27N7O4

Molecular Weight: 489.54

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCC(=O)Nc1cccc(CNc2nc(Nc3cc(OC)cc(OC)c3)c(C(N)=O)c3nccn23)c1

Standard InChI:  InChI=1S/C25H27N7O4/c1-4-20(33)29-16-7-5-6-15(10-16)14-28-25-31-23(21(22(26)34)24-27-8-9-32(24)25)30-17-11-18(35-2)13-19(12-17)36-3/h5-13,30H,4,14H2,1-3H3,(H2,26,34)(H,28,31)(H,29,33)

Standard InChI Key:  GKMDWGVWNNSGTH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   28.1337   -3.5209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1337   -4.3459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8458   -4.7543    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.5578   -4.3459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8458   -3.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5548   -3.5192    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.1685   -2.9731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8388   -2.2207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0215   -2.3018    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.2725   -4.7581    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.2728   -5.5831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9875   -5.9953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4181   -3.1105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4156   -2.2855    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.7048   -3.5251    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.4199   -4.7594    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.4211   -5.5844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7059   -5.9957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7067   -6.8201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4223   -7.2323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1386   -6.8143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1342   -5.9914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8551   -7.2233    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.8592   -8.0483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9926   -7.2332    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.9934   -8.0582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9856   -6.8178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6993   -7.2299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4146   -6.8171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4117   -5.9879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6973   -5.5795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1246   -5.5725    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.8406   -5.9822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5535   -5.5669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8439   -6.8072    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.2696   -5.9766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  1  5  1  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  2  0
  4 10  1  0
 10 11  1  0
 11 12  1  0
  1 13  1  0
 13 14  1  0
 13 15  2  0
  2 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 21 23  1  0
 23 24  1  0
 19 25  1  0
 25 26  1  0
 12 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 12  1  0
 30 32  1  0
 32 33  1  0
 33 34  1  0
 33 35  2  0
 34 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4849832

    ---

Associated Targets(Human)

ZAP70 Tchem Tyrosine-protein kinase ZAP-70 (2189 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SYK Tclin Tyrosine-protein kinase SYK (7372 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 489.54Molecular Weight (Monoisotopic): 489.2125AlogP: 3.55#Rotatable Bonds: 10
Polar Surface Area: 144.90Molecular Species: NEUTRALHBA: 9HBD: 4
#RO5 Violations: HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.69CX Basic pKa: 5.10CX LogP: 3.25CX LogD: 3.25
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.26Np Likeness Score: -1.36

References

1. Rao D, Li H, Ren X, Sun Y, Wen C, Zheng M, Huang H, Tang W, Xu S..  (2021)  Discovery of a potent, selective, and covalent ZAP-70 kinase inhibitor.,  219  [PMID:33845236] [10.1016/j.ejmech.2021.113393]

Source