10-(4-butoxyphenyl)-7,8-dihydro-5H-indeno[1,2-b]quinoline-9,11(6H,10H)-dione

ID: ALA4849977

PubChem CID: 155088328

Max Phase: Preclinical

Molecular Formula: C26H25NO3

Molecular Weight: 399.49

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCOc1ccc(C2C3=C(CCCC3=O)NC3=C2C(=O)c2ccccc23)cc1

Standard InChI:  InChI=1S/C26H25NO3/c1-2-3-15-30-17-13-11-16(12-14-17)22-23-20(9-6-10-21(23)28)27-25-18-7-4-5-8-19(18)26(29)24(22)25/h4-5,7-8,11-14,22,27H,2-3,6,9-10,15H2,1H3

Standard InChI Key:  BKUPRUCRWFKGOB-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
   23.2595   -4.1824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2595   -2.5311    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.9721   -2.9482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9685   -3.7738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6779   -4.1873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3953   -3.7798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3988   -2.9543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6849   -2.5361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5469   -3.7738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5470   -2.9482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7616   -4.0289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2764   -3.3609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7622   -2.6946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4280   -1.9428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6081   -1.8561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1237   -2.5273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4606   -3.2765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2595   -5.0065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5432   -5.4195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5438   -6.2444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2598   -6.6572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9767   -6.2392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9727   -5.4157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6733   -5.0130    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.5065   -4.8140    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.2618   -7.4829    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.5478   -7.8974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5497   -8.7231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2657   -9.1342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9798   -8.7196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 10  2  1  0
  9  1  1  0
  1  4  1  0
  3  2  1  0
  3  4  2  0
  3  8  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  9 10  2  0
 10 13  1  0
 12 11  1  0
 11  9  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
  1 18  1  0
  5 24  2  0
 11 25  2  0
 21 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4849977

    ---

Associated Targets(Human)

GPR174 Tchem Probable G-protein coupled receptor 174 (370 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 399.49Molecular Weight (Monoisotopic): 399.1834AlogP: 5.17#Rotatable Bonds: 5
Polar Surface Area: 55.40Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 4.08CX LogD: 4.08
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.71Np Likeness Score: -0.56

References

1.  (2020)  Inhibitors of GPR174 and Uses Thereof, 
2.  (2020)  Methods and Compositions for Treating Cancer, 

Source