The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-((5-chloro-2-((4-(4-methoxypiperidin-1-yl)phenyl)amino)pyrimidin-4-yl)oxy)phenyl)propionamide ID: ALA4850011
PubChem CID: 164611114
Max Phase: Preclinical
Molecular Formula: C25H28ClN5O3
Molecular Weight: 481.98
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCC(=O)Nc1cccc(Oc2nc(Nc3ccc(N4CCC(OC)CC4)cc3)ncc2Cl)c1
Standard InChI: InChI=1S/C25H28ClN5O3/c1-3-23(32)28-18-5-4-6-21(15-18)34-24-22(26)16-27-25(30-24)29-17-7-9-19(10-8-17)31-13-11-20(33-2)12-14-31/h4-10,15-16,20H,3,11-14H2,1-2H3,(H,28,32)(H,27,29,30)
Standard InChI Key: NRJOZUDSPRDIMA-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
7.3616 -10.4419 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.3604 -11.2614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0685 -11.6704 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7781 -11.2609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7753 -10.4383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0667 -10.0330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6524 -11.6694 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9450 -11.2603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4865 -11.6684 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1935 -11.2587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9502 -10.4432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2436 -10.0341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5346 -10.4422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5366 -11.2636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2437 -11.6690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8986 -11.6666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6051 -11.2576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6043 -10.4395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8910 -10.0322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1873 -10.4436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3133 -11.6654 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.0206 -11.2561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7287 -11.6639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4360 -11.2545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0197 -10.4389 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8267 -10.0340 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8263 -9.2168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1192 -10.4430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4113 -10.0348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1183 -8.8086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4108 -9.2176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7029 -8.8094 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9954 -9.2183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4815 -10.0270 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
7 8 1 0
4 9 1 0
9 10 1 0
8 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 8 1 0
10 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 10 1 0
17 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
22 25 2 0
13 26 1 0
26 27 1 0
26 28 1 0
28 29 1 0
27 30 1 0
29 31 1 0
30 31 1 0
31 32 1 0
32 33 1 0
5 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 481.98Molecular Weight (Monoisotopic): 481.1881AlogP: 5.63#Rotatable Bonds: 8Polar Surface Area: 88.61Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.68CX Basic pKa: 5.80CX LogP: 4.87CX LogD: 4.86Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.43Np Likeness Score: -1.66
References 1. Yang H, Wang X, Wang C, Yin F, Qu L, Shi C, Zhao J, Li S, Ji L, Peng W, Luo H, Cheng M, Kong L.. (2021) Optimization of WZ4003 as NUAK inhibitors against human colorectal cancer., 210 [PMID:33310286 ] [10.1016/j.ejmech.2020.113080 ]