(1R,5S,6r)-N6-((S)-1-(3-cyanopyridin-2-yl)pyrrolidin-3-yl)-N3-ethyl-N3-methyl-3-azabicyclo[3.1.0]hexane-3,6-dicarboxamide

ID: ALA4850025

PubChem CID: 164611121

Max Phase: Preclinical

Molecular Formula: C20H26N6O2

Molecular Weight: 382.47

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCN(C)C(=O)N1C[C@@H]2[C@H](C1)[C@H]2C(=O)N[C@H]1CCN(c2ncccc2C#N)C1

Standard InChI:  InChI=1S/C20H26N6O2/c1-3-24(2)20(28)26-11-15-16(12-26)17(15)19(27)23-14-6-8-25(10-14)18-13(9-21)5-4-7-22-18/h4-5,7,14-17H,3,6,8,10-12H2,1-2H3,(H,23,27)/t14-,15-,16+,17+/m0/s1

Standard InChI Key:  POQSTGUDHHBHHP-MWDXBVQZSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    7.7798   -5.0476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5970   -5.0476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8514   -4.2709    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1884   -3.7888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5296   -4.2709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6198   -4.0225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7523   -4.0187    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1453   -4.5658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3680   -4.3136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3156   -5.3651    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5694   -4.4878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8222   -3.7092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1599   -3.2282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4977   -3.7094    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7509   -4.4879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3984   -3.1243    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7793   -5.2746    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7204   -3.4571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5504   -2.6578    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1133   -4.0040    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3139   -3.8349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1988   -4.8173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7677   -4.4427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2141   -4.5666    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.9797   -4.3211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1529   -3.5320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7795   -3.2361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5531   -2.9884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1682   -2.6940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5596   -2.1487    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  3  6  1  0
  5  7  1  6
  7  8  1  0
  9  8  1  1
  8 10  2  0
 12  9  1  0
  9 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 11  1  0
 12 16  1  1
 11 17  1  1
 14 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  1  0
 22 20  1  0
 21 23  1  0
  6 24  2  0
  6 27  1  0
 24 25  1  0
 25 26  2  0
 26 28  1  0
 27 28  2  0
 29 30  3  0
 27 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4850025

    ---

Associated Targets(Human)

ACKR3 Tchem C-X-C chemokine receptor type 7 (1102 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 382.47Molecular Weight (Monoisotopic): 382.2117AlogP: 0.90#Rotatable Bonds: 4
Polar Surface Area: 92.57Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.83CX LogP: -0.15CX LogD: -0.15
Aromatic Rings: 1Heavy Atoms: 28QED Weighted: 0.84Np Likeness Score: -1.69

References

1. Aspnes GE, Menhaji-Klotz E, Boehm M, Londregan AT, Lee ECY, Limberakis C, Coffey SB, Brown JA, Jones RM, Hesp KD..  (2021)  Discovery and evaluation of non-basic small molecule modulators of the atypical chemokine receptor CXCR7.,  50  [PMID:34400299] [10.1016/j.bmcl.2021.128320]

Source